First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms.
So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is
HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
Oleic acid + Sodium hydroxide ----> (Oleic acid; Sodium salt) + Water
C17H33COOH + NaOH ----> C17H33COONa + H2O
HOOC-CH(OH)-CH(OH)-COOH + 2NaOH = Na+-OOC-CH(OH)-CH(OH)-COO-Na+ + 2H2O
Oleic acid + sodium hydroxide -> sodium oleate + water
C17H33COOH + NaOH -> C17H33COONa + H2O
The balanced equation is: Ca(NO3)2 + 2NaOH → Ca(OH)2 + 2NaNO3
Al + NaOH Um this is the "equation" of aluminum and Sodium Hydroxide... Na2CO3(aq) + NaOH (aq) --> NO reaction Sodium carbonate + Sodium hydroxide yields no visible reaction
There is no reaction, therefore no equation!!
There is no reaction between phenol and sodium carbonate
copper bromide + sodium Hydroxide = Copper Hydroxide + Sodium Bromide CuBr2 + 2NaOH = Cu (OH)2 + 2NaBr
There is no reaction , because of the Common Ion Effect. The Common Ion is the Hydroxide.
H3NSO3 + NaOH = NaSO3NH2 + H2O
HOC6H4COOH + NaOH = HOC6H4COONa + H2O
It doesn't need balancing - it's already balanced. NaHCO3 + NaOH → Na2CO3 + H2O
The balanced equation is: Ca(NO3)2 + 2NaOH → Ca(OH)2 + 2NaNO3
Simplified. 2NaOH + H2SO4 -> Na2SO4 + 2H2O
Al + NaOH Um this is the "equation" of aluminum and Sodium Hydroxide... Na2CO3(aq) + NaOH (aq) --> NO reaction Sodium carbonate + Sodium hydroxide yields no visible reaction
The chemical reaction is: NH4NO3 + NaOH -----→ NH3 + H2O + NaNO3
There isn't one because there is no reaction beyond the catalysis of the decomposition of the peroxide.
The chemical reaction is: NH4NO3 + NaOH ---------→ NH3 + H2O + NaNO3
MnBr2 + 2NaOH -> Mn(OH)2 + 2NaBr
There is no reaction between these, because all species are soluble.