0
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
Wiki User
∙ 13y ago
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms.
So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is
HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
Wiki User
∙ 11y ago
Wiki User
∙ 13y agoOleic acid + Sodium hydroxide ----> (Oleic acid; Sodium salt) + Water
C17H33COOH + NaOH ----> C17H33COONa + H2O
Wiki User
∙ 14y agoHOOC-CH(OH)-CH(OH)-COOH + 2NaOH = Na+-OOC-CH(OH)-CH(OH)-COO-Na+ + 2H2O
Aditya Hirey
Oleic acid + sodium hydroxide -> sodium oleate + water
C17H33COOH + NaOH -> C17H33COONa + H2O
Add your answer:
Earn +20 pts
What is the equation for the reaction calcium nitrate and sodium hydroxide which produces calcium hydroxide and sodium nitrate?
The balanced equation is: Ca(NO3)2 + 2NaOH → Ca(OH)2 + 2NaNO3
What is the balanced equation for the reaction of calcicum nitrate and sodium hydroxide?
Al + NaOH Um this is the "equation" of aluminum and Sodium Hydroxide... Na2CO3(aq) + NaOH (aq) --> NO reaction Sodium carbonate + Sodium hydroxide yields no visible reaction
What is the equation for the reaction between cyclohexane and sodium hydroxide?
There is no reaction, therefore no equation!!
Balanced equation for the reaction of phenol and sodium carbonate?
There is no reaction between phenol and sodium carbonate
What is the balanced reaction between Sodium Hydroxide and Copper Bromide?
copper bromide + sodium Hydroxide = Copper Hydroxide + Sodium Bromide CuBr2 + 2NaOH = Cu (OH)2 + 2NaBr
What is the balanced equation for zinc hydroxide react with excess sodium hydroxide?
There is no reaction , because of the Common Ion Effect. The Common Ion is the Hydroxide.
What is the balanced equation for the reaction of amidosulphuric acid and sodium hydroxide?
H3NSO3 + NaOH = NaSO3NH2 + H2O
What is the balanced equation for the reaction of salicyclic acid and sodium hydroxide?
HOC6H4COOH + NaOH = HOC6H4COONa + H2O
What is the balanced equation for the reaction of sodium bicarbonate and sodium hydroxide?
It doesn't need balancing - it's already balanced. NaHCO3 + NaOH → Na2CO3 + H2O
What is the equation for the reaction calcium nitrate and sodium hydroxide which produces calcium hydroxide and sodium nitrate?
The balanced equation is: Ca(NO3)2 + 2NaOH → Ca(OH)2 + 2NaNO3
What is the balanced chemical equation for reaction for the reaction of a sodium hydroxide solution with sulfuric acid?
Simplified. 2NaOH + H2SO4 -> Na2SO4 + 2H2O
What is the balanced equation for the reaction of calcicum nitrate and sodium hydroxide?
Al + NaOH Um this is the "equation" of aluminum and Sodium Hydroxide... Na2CO3(aq) + NaOH (aq) --> NO reaction Sodium carbonate + Sodium hydroxide yields no visible reaction
What is the balanced equation for ammonium nitrate and sodium hydroxide?
The chemical reaction is: NH4NO3 + NaOH -----→ NH3 + H2O + NaNO3
What is the balanced equation for hydrogen peroxide and sodium hydroxide?
There isn't one because there is no reaction beyond the catalysis of the decomposition of the peroxide.
What is the balanced equation for sodium hydroxide ammonium nitrate?
The chemical reaction is: NH4NO3 + NaOH ---------→ NH3 + H2O + NaNO3
What is the balanced equation for the reaction of manganese bromide and sodium hydroxide are combined?
MnBr2 + 2NaOH -> Mn(OH)2 + 2NaBr
What is the balanced ionic equation for when ammonium phosphate react with sodium hydroxide?
There is no reaction between these, because all species are soluble.
