0
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms.
So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is
HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
What else can I help you with?
What is the balanced reaction between Sodium Hydroxide and Copper Bromide?
copper bromide + sodium Hydroxide = Copper Hydroxide + Sodium Bromide CuBr2 + 2NaOH = Cu (OH)2 + 2NaBr
What is the balanced equation for the reaction of calcicum nitrate and sodium hydroxide?
Al + NaOH Um this is the "equation" of aluminum and Sodium Hydroxide... Na2CO3(aq) + NaOH (aq) --> NO reaction Sodium carbonate + Sodium hydroxide yields no visible reaction
What is the equation for the reaction calcium nitrate and sodium hydroxide which produces calcium hydroxide and sodium nitrate?
The balanced chemical equation for the reaction is: Ca(NO3)2 + 2NaOH -> Ca(OH)2 + 2NaNO3. This equation shows that one molecule of calcium nitrate reacts with two molecules of sodium hydroxide to produce one molecule of calcium hydroxide and two molecules of sodium nitrate.
What is the balanced equation for ammonium phosphate and sodium hydroxide?
(NH4)3PO4 + 3NaOH -------> Na3PO4 + 3NH3 + 3H2O
What is the balanced equation when hydrogen sulfate and sodium hydroxide react?
H2+SO4-2 + 2Na+OH- >>> Na2SO4 + 2 H2O
What is the balanced equation for the reaction of fatty acids and sodium hydroxide?
The balanced equation for the reaction of a fatty acid (such as stearic acid) and sodium hydroxide is: C17H35COOH + NaOH -> C17H35COONa + H2O This reaction produces a salt (sodium stearate) and water.
What is the balanced equation for the reaction of salicyclic acid and sodium hydroxide?
The balanced equation for the reaction between salicylic acid and sodium hydroxide is: C7H6O3 + NaOH → C7H5NaO3 + H2O
What is the balanced equation for fatty acid and sodium hydroxide?
The balanced equation for the reaction between a fatty acid (such as oleic acid) and sodium hydroxide is: Fatty acid + Sodium hydroxide -> Soap (sodium salt of the fatty acid) + Water
What is the balanced equation for the reaction of castor oil and sodium hydroxide?
The balanced equation for the reaction of castor oil (triglyceride) and sodium hydroxide (NaOH) is: Triglyceride + 3NaOH → Glycerol + 3Soap This reaction is known as saponification, which produces glycerol and soap molecules from the reaction between the ester bonds in the triglyceride and the hydroxide ions in sodium hydroxide.
What is the balanced equation for zinc hydroxide react with excess sodium hydroxide?
There is no reaction between zinc hydroxide and sodium hydroxide.
What is the balanced equation for the reaction of stearic acid and sodium hydroxide?
Stearic Acid + Sodium Hydroxide = Sodium Stearate (soap) + Water. C18H36OOH + NaOH = C18H36OONa + H2O
What is the balanced equation for the reaction of amidosulphuric acid and sodium hydroxide?
The balanced equation for the reaction between amidosulfuric acid (NH2SO3H) and sodium hydroxide (NaOH) is: NH2SO3H + NaOH → NaHSO3 + H2O
What is the balanced chemical equation for reaction for the reaction of a sodium hydroxide solution with sulfuric acid?
Simplified. 2NaOH + H2SO4 -> Na2SO4 + 2H2O
What is the balanced equation for hydrogen peroxide and sodium hydroxide?
There isn't one because there is no reaction beyond the catalysis of the decomposition of the peroxide.
Reaction between sodium hydroxide and methanol?
When sodium hydroxide reacts with methanol, a neutralization reaction occurs, forming sodium methoxide and water. The balanced chemical equation for this reaction is: CH3OH + NaOH → CH3ONa + H2O
What is the balanced equation for sodium hydroxide ammonium nitrate?
The chemical reaction is: NH4NO3 + NaOH ---------→ NH3 + H2O + NaNO3
What is the balanced equation for the reaction of manganese bromide and sodium hydroxide are combined?
The balanced equation for the reaction between manganese(II) bromide and sodium hydroxide is: MnBr2 + 2NaOH → Mn(OH)2 + 2NaBr.
