0
What is the balanced equation for the reaction of stearic acid and sodium hydroxide?
Stearic Acid + Sodium Hydroxide = Sodium Stearate (soap) + Water.
C18H36OOH + NaOH = C18H36OONa + H2O
What else can I help you with?
What is the balanced equation for the reaction of fatty acids and sodium hydroxide?
The balanced equation for the reaction of a fatty acid (such as stearic acid) and sodium hydroxide is: C17H35COOH + NaOH -> C17H35COONa + H2O This reaction produces a salt (sodium stearate) and water.
What is the balanced equation for the reaction of stearic acid with calcium hydroxide?
The balanced equation for the reaction between stearic acid (C18H36O2) and calcium hydroxide (Ca(OH)2) is: 2C18H36O2 + 3Ca(OH)2 → 2Ca(C18H35O2)2 + 6H2O This reaction produces calcium stearate and water.
Chmical reaction when stearic acid add KOH?
When stearic acid is added to potassium hydroxide (KOH), it undergoes saponification to form potassium stearate and water. This reaction is commonly used in soap making processes. The reaction can be represented by the chemical equation: C17H35COOH + KOH -> C17H35COOK + H2O
What is reaction equation of zinc oxide and stearic acid?
As posted, the question would logically refer to a reaction in the solid state - there is no reaction. There is also none in water solution as stearic acid is not significantly water-soluable. The reaction between the two would produce zinc stearate and water.
Why are sodium stearate solutions alkaline?
Because 'sdoium stearate' is the conjugate base of the weak carboxylic acid 'stearic acid'. Since a solution of stearic acid would be slightly acidic, a solution of sodium stearate will be basic or alkaline.
What is the balanced equation for the reaction of fatty acids and sodium hydroxide?
The balanced equation for the reaction of a fatty acid (such as stearic acid) and sodium hydroxide is: C17H35COOH + NaOH -> C17H35COONa + H2O This reaction produces a salt (sodium stearate) and water.
What is the balanced equation for the reaction of stearic acid with calcium hydroxide?
The balanced equation for the reaction between stearic acid (C18H36O2) and calcium hydroxide (Ca(OH)2) is: 2C18H36O2 + 3Ca(OH)2 → 2Ca(C18H35O2)2 + 6H2O This reaction produces calcium stearate and water.
Chmical reaction when stearic acid add KOH?
When stearic acid is added to potassium hydroxide (KOH), it undergoes saponification to form potassium stearate and water. This reaction is commonly used in soap making processes. The reaction can be represented by the chemical equation: C17H35COOH + KOH -> C17H35COOK + H2O
What is the equation for the preparation of soap from stearic acid and sodium hydroxide?
Well, to write it out is complex, but I will do my best: C18H36O2 + NaOH = alcohol + salt of the carboxylic acid (soap) The proper name for this process saponification, and the specific products can be determined via GC analysis or through your own tedious calculations.
What is reaction equation of zinc oxide and stearic acid?
As posted, the question would logically refer to a reaction in the solid state - there is no reaction. There is also none in water solution as stearic acid is not significantly water-soluable. The reaction between the two would produce zinc stearate and water.
Equation of saponification using oleopalmitostearin as triglyceride?
CH2OCO(CH2)7CH=CH(CH2)7CH3 CH2OH CH3(CH2)7CH=CH(CH2)7COONa | | + CHOCO(CH12)12CH3 + 3NaOH ---> CHOH + CH3(CH2)14COONa | | + CH2OCO(CH2)16CH3 CH2OH CH3(CH2)16COONa
What is the balance equation of calcium oxide and stearic acid?
Calcium oxide + Stearic Acid = Calcium Stearate + Water CaO + 2C18H36OOH = (C18H36OO)2Ca + H2O NB CAlcium stearate is the 'scum' that can appear on the side of a bath, when washing in 'hard' water.
What is the method of preparation aluminum stearate?
Aluminum stearate can be prepared by reacting stearic acid with an aluminum salt (such as aluminum chloride) in a solvent like toluene or xylene. The reaction typically occurs in the presence of a base, followed by filtration and drying to obtain the aluminum stearate product.
Why are sodium stearate solutions alkaline?
Because 'sdoium stearate' is the conjugate base of the weak carboxylic acid 'stearic acid'. Since a solution of stearic acid would be slightly acidic, a solution of sodium stearate will be basic or alkaline.
Write the equation of the action of pancreatin on a molecule of tristearin?
Tristearin is a type of triglyceride which is found in hard fat deposits. The chemical equation for the action of pancreatin on tristearin is triglyceride + 2H2O --> 2HO(O=C)C17H35 + monoglyceride.
How calcium stearate is prepared?
Calcium stearate is typically prepared by reacting stearic acid with calcium hydroxide to form calcium stearate and water. The reaction is carried out at elevated temperatures with stirring to ensure complete conversion of the raw materials. The resulting calcium stearate can then be purified and dried for use in various applications.
What acid is in soap?
Soap often contains fatty acids such as oleic acid, palmitic acid, and stearic acid. These acids are the result of the saponification process, where fats and oils are combined with sodium hydroxide (lye) to produce soap.
