Words: Iron (III) oxide reacts with hydrogen gas produces solid iron and water.
Symbols: Fe2O3 + H2 --> Fe + H2O
Balanced final equation: Fe2O3 + 3H2 --> 2Fe + 3H2O Remember:
- Hydrogen is diatomic so you need the subscript 2 when in gas form.
- This is a single displacement reaction.
chemical equation to iron III oxide when it reacts with hydrogen sulfide .The reaction of iron (hydr)oxides with dissolved sulphide is also accompanied by a distinct colour change due to the formation of black FeS(s) which, under appropriate conditions, may be used as a rapid indicator of sulphidic conditions.
The balanced equation is: Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
The reaction is:
Fe2O3 + H2O + 3 H2S = Fe2S3 + 4 H2O
The chemical equation is:
3 Fe(OH)2---------------------Fe3O4 + 2 H2O + H2
Iron(III) oxide doesn't reacts with water.
Fe2O3(s)+3H2(g)=2Fe(s)+3H2O(l)
Carbon (C) + Oxygen (O2) = CO2
Na2O + CO2 -> Na2CO3 Balanced as is and I would call this a synthesis reaction.
no
Na2O + CO2 >> Na2CO3Balanced. Single displacement, I think. SYNTHESIS
When carbon reacts with oxygen to form carbon dioxide, carbon dioxide is the product of the reaction.
SiO2 + 2Ca --> 2CaO + Si
Carbon (C) + Oxygen (O2) = CO2
CaCO3 + 2HCl -> CaCl2 + CO2 + H2O
C2h6+7o=2co2+3h2o
Na2O + CO2 -> Na2CO3 Balanced as is and I would call this a synthesis reaction.
no
When carbon reacts with oxygen to form carbon dioxide, carbon dioxide is the product of the reaction.
Na2O + CO2 >> Na2CO3Balanced. Single displacement, I think. SYNTHESIS
This answer represents a balanced chemical equation for the combustion of propane (C3H8). When propane reacts with oxygen (O2), it produces carbon dioxide (CO2) and water (H2O).
The balanced equation is: C_12 H_22 O_11 (aq)+H_2O(l)------------>4C_2 H_5 OH(aq)+4CO_2(g)
1 atom of carbon (C) reacts with 2 atoms of oxygen (O2) to form the compound carbon dioxide (CO2).
Ca(OH)2 + CO2 -----> CaCO3 + H2O + 74 kJ/mol