answersLogoWhite

0


Best Answer

Formula: KMnO4

User Avatar

Wiki User

13y ago
This answer is:
User Avatar
More answers
User Avatar

Wiki User

15y ago

kmno4

This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is the chemical formula for Condys Crystals?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What is the chemical formula of the liquid crystals used in LCD?

Part of the chemical formula for an LCD is C6 H13 O (MESOGEN). This is the unit in the liquid chrystal that is responsible for the structural order of the liquid crystals.


What does AI2O3 mean?

AI2O3 is the chemical formula for sapphire crystals: http://www.redoptronics.com/Sapphire-crystal.html


What is an augelite?

An augelite is a mineral with monoclinic crystals, with the chemical formula Al2(PO4)(OH)3.


Is marble a smooth and contains shiny crystals?

Marble (with the chemical formula CaCO3) is a crystalline material.


What is zoisite?

Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).


What is the chemical formula for native selenium?

The chemical formula for element selenium is indicated by se. Native selenium is a rare mineral which does not usually forms good crystals. Hence it is used in the manufacture of specimens


What is the formula for chloride dioxide?

Chlorine dioxide is a chemical compound with the formula ClO2. This yellowish-green gas crystallizes as bright orange crystals at −59 °C


What is the chemical formulas for Iodine Crystals?

Formula: I2


What is autunite?

Autunite is a yellow mineral with tetragonal crystals, chemical formula Ca(UO2)2(PO4)2·10-12H2O.


Chemical formula for drano?

Drano crystals contain 30-60% sodium hydroxide (NaOH) and 15-40% sodium nitrate (NaNO3).


What is the formula for copper sulfate crystals How much water do the 'home grown' crystals contain?

Well the formula is CuSO4


What is the formula for potassium floride?

The chemical formula of potassium ferrocyanide is K4[Fe(CN)6].3H2O; the crystals are monoclinic.