answersLogoWhite

0

C10H8N4O2NH2(OH)2(PO3H)3H

User Avatar

Wiki User

16y ago

What else can I help you with?

Related Questions

What is the formula for adenine?

The empirical formula for adenine is CHN.The molecular formula is C5H5N5.


What is the chemical symbol for adenine?

The chemical symbol for Adenine is: C5H5N5Adenine is abbreviated as: A or Ade


What is the chemical name for C5H5N5?

It is the chemical formula for any one of these= Adenine (or 9H-purin-6-amine)= 2-Aminopurine (or 7H-purin-2-amine)


How many adenine's are there?

Adenine is a chemical compound. Without context the question is meaningless.


What is the simple formula of adenine?

C5h5n5


What are the parts of adenosine diphosphate Yall Dumb?

Adenosine diphosphate, or ADP, has the chemical formula C10H15N5O10P2. It is a nucleotide that is composed of adenine, ribose, and two phosphate units.


what is the Chemical formula for life?

The chemical formula for life is C6H12O6, which represents glucose, a crucial molecule for energy production in living organisms. Other essential molecules for life include DNA, which is composed of nucleotides containing phosphorus and nitrogenous bases such as adenine, thymine, cytosine, and guanine.


How are adenine and thymine different?

Adenine and thymine are both nitrogenous bases.Adenine is a purine, meaning it has a six-membered ring of carbon and nitrogen atoms fused together with a five-membered ring of carbon and nitrogen atoms. The chemical formula of adenine is C5H5N5.Thymine is smaller; it is a pyrimidine, meaning it has a six-membered ring of carbon and nitrogen atoms. The chemical formula for thymine is C5H6N2O2.


What type of mutagen changes Adenine into Hypoxanthine?

chemical mutagens


What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.


What are the three different chemical components?

Ribose,Adenine,and Sugar. NovaNet:)


What is the chemical name for formula?

chemical formula