C10H8N4O2NH2(OH)2(PO3H)3H
The empirical formula for adenine is CHN.The molecular formula is C5H5N5.
The chemical symbol for Adenine is: C5H5N5Adenine is abbreviated as: A or Ade
It is the chemical formula for any one of these= Adenine (or 9H-purin-6-amine)= 2-Aminopurine (or 7H-purin-2-amine)
Adenine is a chemical compound. Without context the question is meaningless.
C5h5n5
Adenosine diphosphate, or ADP, has the chemical formula C10H15N5O10P2. It is a nucleotide that is composed of adenine, ribose, and two phosphate units.
Adenine and thymine are both nitrogenous bases.Adenine is a purine, meaning it has a six-membered ring of carbon and nitrogen atoms fused together with a five-membered ring of carbon and nitrogen atoms. The chemical formula of adenine is C5H5N5.Thymine is smaller; it is a pyrimidine, meaning it has a six-membered ring of carbon and nitrogen atoms. The chemical formula for thymine is C5H6N2O2.
The chemical formula for life is C6H12O6, which represents glucose, a crucial molecule for energy production in living organisms. Other essential molecules for life include DNA, which is composed of nucleotides containing phosphorus and nitrogenous bases such as adenine, thymine, cytosine, and guanine.
chemical mutagens
Energy has no chemical formula as it is not a chemical.
Ribose,Adenine,and Sugar. NovaNet:)
chemical formula