answersLogoWhite

0

C5h5n5

User Avatar

Wiki User

16y ago

What else can I help you with?

Related Questions

What is the formula for adenine?

The empirical formula for adenine is CHN.The molecular formula is C5H5N5.


What is the chemical formula for adenine triphosophate?

C10H8N4O2NH2(OH)2(PO3H)3H


How many adenine molecules are in ATP?

There are five carbon atoms in adenine.Its molecular formula is C5H5N5.For structural formulae, see the link below.


what is the formula of simple interest?

The formula for simple interest is: A=P(1+rt)


What is the base that joins adenine?

adenine is one of the 4 base pairs in a dna structure ,A and T(thymine), and C and G, simple !


What is a simple sentence using the word chemical formula?

This is a simple sentence using the words "chemical formula".


What two bases are in purines?

Adenine and guanine are the two purines bases present in DNA.Two purines in DNA are adenine and guanine.


What is in an expression?

In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.


Find the formula of simple interest?

the formula for simple interest is I=PRT (interest=principal x rate x time )


What is an expression in excel?

In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.


How are adenine and thymine different?

Adenine and thymine are both nitrogenous bases.Adenine is a purine, meaning it has a six-membered ring of carbon and nitrogen atoms fused together with a five-membered ring of carbon and nitrogen atoms. The chemical formula of adenine is C5H5N5.Thymine is smaller; it is a pyrimidine, meaning it has a six-membered ring of carbon and nitrogen atoms. The chemical formula for thymine is C5H6N2O2.


What is the formula to calculate the period of a wave?

you find the formula... then you calculate it. Its that simple.