C5h5n5
The empirical formula for adenine is CHN.The molecular formula is C5H5N5.
C10H8N4O2NH2(OH)2(PO3H)3H
There are five carbon atoms in adenine.Its molecular formula is C5H5N5.For structural formulae, see the link below.
The formula for simple interest is: A=P(1+rt)
adenine is one of the 4 base pairs in a dna structure ,A and T(thymine), and C and G, simple !
This is a simple sentence using the words "chemical formula".
Adenine and guanine are the two purines bases present in DNA.Two purines in DNA are adenine and guanine.
In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.
the formula for simple interest is I=PRT (interest=principal x rate x time )
In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.In Excel an expression is a simple formula and would not have complex parts or complicated functions in it.
Adenine and thymine are both nitrogenous bases.Adenine is a purine, meaning it has a six-membered ring of carbon and nitrogen atoms fused together with a five-membered ring of carbon and nitrogen atoms. The chemical formula of adenine is C5H5N5.Thymine is smaller; it is a pyrimidine, meaning it has a six-membered ring of carbon and nitrogen atoms. The chemical formula for thymine is C5H6N2O2.
you find the formula... then you calculate it. Its that simple.