0
What is the condensed structural formula for 1 3-dimethylcyclohexane?
Wiki User
∙ 12y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the correct condensed structural formula for 1-pentene?
It is CH=-C-CH2-CH2-CH3
What is the condensed structural formula for 1-2-4-trichlorobenzene?
C6H3Cl3 The benzene ring has 6 carbon atoms, each of which is given a number and this continues in a clockwise direction. Chlorine atoms are attached to carbons 1, 2 and 4.
What is the condensed structural formula for pentanol?
Propanol (1-propanol) is the chemical name for the molecular formula of C3H8O. The structure of 1-propanol is: H C C I I IH-C-C -C-OH I I I H H H
What is the structural formula of 1 2 ethanediol?
(ch2-oh)
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the correct condensed structural formula for 1-pentene?
It is CH=-C-CH2-CH2-CH3
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
What is the Structural formula for 3-methyl-1-butene?
structural formula of c5h10
What is the condensed structural formula and name of ester for 1-pentanol and acetic acid?
This is an esterification reaction that produces pentyl ethanoate as its product. If I remember correctly, pentyl ethanoate smells of pear drops. The general rule here is that any alc1ohol will react with any alk2anoic acid to produce the corresponding ester alk1yl alk2anoate. Oh, and it's pentan-1-ol btw, not 1-pentanol.
What is the structural formula of a butanol molecule?
Assuming you want the structural formula of 'Butan-1-ol' it is CH3CH3CH3CH2OH
What is the condensed structural formula for 1-2-4-trichlorobenzene?
C6H3Cl3 The benzene ring has 6 carbon atoms, each of which is given a number and this continues in a clockwise direction. Chlorine atoms are attached to carbons 1, 2 and 4.
What is the structural formula for 1 2-dichlorobenzene?
C6H4Cl2
What is the condensed structural formula for pentanol?
Propanol (1-propanol) is the chemical name for the molecular formula of C3H8O. The structure of 1-propanol is: H C C I I IH-C-C -C-OH I I I H H H
What gas represents the chemical formula C4H10?
C4H10 is the molecular formula for Butane. Butane has two possible *structural formulas* which describe the way in which the molecule is constructed. n-Butane has the condensed structural formula of CH3CH2CH2CH3. In this isomer of Butane each Carbon is bonded to another forming a chain with Hydrogens bonded to each of the carbons, 3 to the Carbon on each end, and 2 to each Carbon in the center. Isobutane has the condensed structural formula of CH(CH3)3. In this isomer, 3 Carbons are bonded to a single Carbon atom in the center of the molecule. The outer Carbons have 3 Hydrogens bonded to them, and the center Carbon has 1 Hydrogen bonded to it.
What is the structural formula of 1 2 ethanediol?
(ch2-oh)
What is the molecule structural formula for propanol?
The formula for propan-1-ol is CH3CH2CH2OH The formula for propan-2-ol is CH3CHOHCH3
