0
In the example of staggered ethane in Newman projection, a hydrogen atom on one carbon atom has a 60° torsion angle with respect to the nearest hydrogen atom on the other carbon, so that steric hindrance is minimised.
This is picturised in 'Related links', clickable just below this answer.
Wiki User
∙ 11y ago
Wiki User
∙ 13y agoEthane:
H3C-CH3
Wiki User
∙ 14y agoIn ethene molecule two carbons linked through a double bond are linear and two hydrogens attached to one carbon are at an angle of 1200
Wiki User
∙ 15y agoCH3-CH3
Wiki User
∙ 12y agoCh3-ch3 (all capitals)
Wiki User
∙ 11y ago2c(s) + 3h2(g) ----> c2h6(g)
Wiki User
∙ 13y agoim not sure :(
Add your answer:
Earn +20 pts
Is there any structural formula of n ethane and iso ethane like n butane and iso butane?
Ethane has no structural isomers and hence there is no n-ethane and iso-ethane.
Draw the condensed structural formula for 3-decyne?
Ch3ch2ch2ch2ch2ch2c=-cch2ch3
What is the condensed structural formula of hexyl acetate?
Ch3c(=o)(-o-)ch2ch2ch2ch2ch2ch3
Condensed structural formula of methyl propyl ether?
Ch3-o-c3h7
What is the condensed structural formula of butyl propyl amine?
CH3CH2CH2CH2NHCH2CH2CH3
Is there any structural formula of n ethane and iso ethane like n butane and iso butane?
Ethane has no structural isomers and hence there is no n-ethane and iso-ethane.
What is the structural formula of methoxy ethane?
Ch3och2ch3
What is the atomic symbol of ethane?
Ethane is not an atom, but a molecule whose condensed formula is H3C - CH3
What is the condensed structural formula of cyclohexane?
Cyclohexane which is a cycloalkanes, has a structural formula of C6H12. It may be written in a condensed form as (CH2)6.
How does a complete structural formula differ from condensed formula?
The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.
How does a complete structural formula differ from a condensed structural formula?
------ The condensed structural formula is simply a shortened version of the complete structural formula. -------The complete formula indicates all of the carbon and hydrogen atoms. The condenced formula groups the hydrogen atoms with each of the carbon atoms.
What is the difference between structural and condensed formula?
The structural formula show the position of atoms in a molecule.
What is the condensed structural formula of pentyl acetate?
CH3COOCH2CH2CH2CH2CH3
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the condensed structural formula for 4-bromo-2-pentanone?
The formula is C5H9BrO.
Draw the condensed structural formula for 3-decyne?
Ch3ch2ch2ch2ch2ch2c=-cch2ch3
What is the condensed structural formula for 2 4-Dimethylphenol?
The chemical formula of 2,4-dimethylphenol is C8H10O.
