0
What is the difference between sodium bi sulfate and baking soda?
Wiki User
∙ 7y ago
The anion.
Sodium bi-sulphate has the formula NaHSO4 ; The sulphate anion.
Baking soda is sodium bi-carbonate which has the formula NaHCO3 ; the Carbonate anion.
The sulphate anion does not thermally decompose easily.
The carbonate anion thermally decomposes to form water can carbon dioxide, (to make pastry rise).
lenpollock
Add your answer:
Earn +20 pts
What is the difference between sodium sulfide and sodium sulfate?
Sodium sulfate is Na2SO4. Sodium sulfide is Na2S.
Is sodium myreth sulfate like sodium chloride?
No, they are salts, but it is a big difference between these compounds.
What is the difference between halite and gypsum?
Halite is common salt, sodium chloride (NaCl). Gypsum is calcium sulfate (CaSO4·2H2O).
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
What happens when lead II nitrate and sodium sulfate react?
The lead nitrate and sodium sulfate precipitate together and becomes lead sulfate and sodium nitrate. lead nitrate+ sodium sulfate --> lead sulfate + sodium nitrate
What is the difference between sodium sulfide and sodium sulfate?
Sodium sulfate is Na2SO4. Sodium sulfide is Na2S.
Is sodium myreth sulfate like sodium chloride?
No, they are salts, but it is a big difference between these compounds.
What is the reaction between sodium shalphate and water?
Sodium sulfate dissolves in water to produce a solution of sodium sulfate.
What is the difference between NaCl and Na2SO4?
NaCl is sodium chloride and Na2SO4 is sodium sulfate; chemicals with different composition or structure have different chemical and physical properties.
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
What are the ingredients in Purex?
water, sodium laureth sulfate, ethoxylated alchol, sodium bicarbonate (baking soda), polymer, fragrance, brightner, and preservative
What is the difference between halite and gypsum?
Halite is common salt, sodium chloride (NaCl). Gypsum is calcium sulfate (CaSO4·2H2O).
Explain how it is possible for a compound to have both ionic and covalent bounds?
Sodium sulfate is ionically bonded between the sodium ion and the sulfate ion. However, the sulfate ion is covalently bonded between the sulfur and the oxygens.
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
Hi mooches What is the difference between Epson salt and regular salt?
epsomsalt is magnesium sulfate and salt is sodium two separate minerals
What happens when lead II nitrate and sodium sulfate react?
The lead nitrate and sodium sulfate precipitate together and becomes lead sulfate and sodium nitrate. lead nitrate+ sodium sulfate --> lead sulfate + sodium nitrate
What is difference between epson salt and table salt?
Epsom salt is magnesium sulfate (MgSO4·7H2O), table salt is sodium chloride (NaCl).
