answersLogoWhite

0

The anion.

Sodium bi-sulphate has the formula NaHSO4 ; The sulphate anion.

Baking soda is sodium bi-carbonate which has the formula NaHCO3 ; the Carbonate anion.

The sulphate anion does not thermally decompose easily.

The carbonate anion thermally decomposes to form water can carbon dioxide, (to make pastry rise).

User Avatar

lenpollock

Lvl 17
1y ago

What else can I help you with?

Continue Learning about Chemistry

What is the difference between sodium laureth sulfate and sodium lauryl sulfate?

Sodium laureth sulfate and sodium lauryl sulfate are both surfactants commonly used in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher surfactant that can be more irritating to the skin, while sodium laureth sulfate is milder and less likely to cause irritation.


What is the difference between sodium lauryl sulfate and sodium laureth sulfate?

Sodium lauryl sulfate and sodium laureth sulfate are both surfactants commonly found in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher cleansing agent that can be drying to the skin, while sodium laureth sulfate is a milder surfactant that is often preferred for sensitive skin.


What is the chemical formula difference between baking soda and baking powder?

The chemical formula difference between baking soda and baking powder is that baking soda is sodium bicarbonate (NaHCO3) while baking powder is a mixture of sodium bicarbonate and an acid, such as cream of tartar.


What is the difference between sodium sulfate and sodium lauryl sulfate?

Sodium sulfate is a salt commonly used in detergents and textiles, while sodium lauryl sulfate is a surfactant found in personal care products like shampoo and toothpaste. The main difference is their chemical structures and uses, with sodium lauryl sulfate being more commonly used in personal care products for its foaming and cleansing properties.


Is sodium myreth sulfate like sodium chloride?

No, sodium myreth sulfate and sodium chloride are different compounds. Sodium myreth sulfate is a surfactant commonly used in personal care products for its cleansing properties, while sodium chloride is table salt commonly used as a seasoning or food preservative.

Related Questions

What is the difference between sodium laureth sulfate and sodium lauryl sulfate?

Sodium laureth sulfate and sodium lauryl sulfate are both surfactants commonly used in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher surfactant that can be more irritating to the skin, while sodium laureth sulfate is milder and less likely to cause irritation.


What is the difference between sodium lauryl sulfate and sodium laureth sulfate?

Sodium lauryl sulfate and sodium laureth sulfate are both surfactants commonly found in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher cleansing agent that can be drying to the skin, while sodium laureth sulfate is a milder surfactant that is often preferred for sensitive skin.


What is the chemical formula difference between baking soda and baking powder?

The chemical formula difference between baking soda and baking powder is that baking soda is sodium bicarbonate (NaHCO3) while baking powder is a mixture of sodium bicarbonate and an acid, such as cream of tartar.


What is the difference between sodium sulfate and sodium lauryl sulfate?

Sodium sulfate is a salt commonly used in detergents and textiles, while sodium lauryl sulfate is a surfactant found in personal care products like shampoo and toothpaste. The main difference is their chemical structures and uses, with sodium lauryl sulfate being more commonly used in personal care products for its foaming and cleansing properties.


What is the reaction between sodium shalphate and water?

Sodium sulfate dissolves in water to produce a solution of sodium sulfate.


Is sodium myreth sulfate like sodium chloride?

No, sodium myreth sulfate and sodium chloride are different compounds. Sodium myreth sulfate is a surfactant commonly used in personal care products for its cleansing properties, while sodium chloride is table salt commonly used as a seasoning or food preservative.


What is the difference between NaCl and Na2SO4?

NaCl is sodium chloride and Na2SO4 is sodium sulfate; chemicals with different composition or structure have different chemical and physical properties.


What is the difference between sodium sulfide and sodium sulfate?

Sodium sulfide has the chemical formula Na2S and is a white solid with a strong odor, used in various industrial applications like the production of rubber chemicals. Sodium sulfate, with the chemical formula Na2SO4, is a colorless salt that is used in detergents, paper making, and glass manufacturing. The main difference is in their chemical composition and their respective uses.


What are the ingredients in Purex?

water, sodium laureth sulfate, ethoxylated alchol, sodium bicarbonate (baking soda), polymer, fragrance, brightner, and preservative


What is the difference between sodium sulfite and sodium sulfate?

No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."


Is sodium laureth sulfate the same as sodium lauryl sulfate?

No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.


What is the product of silver ion plus sodium sulfate?

The product is silver sulfate, low soluble in water.