0
What is the double replacement for sodium carbonate plus nitric acid?
Wiki User
∙ 6y ago
The chemical reaction is:
Na2CO3 + 2 HNO3 = 2 NaNO3 + CO2 + H2O
Wiki User
∙ 6y ago
Add your answer:
Earn +20 pts
Precipitation of barium carbonate?
The simplest of ways is to mix Ba2+ with CO32- but with precipitation I can't help sorry
What is Na2CO3.10H2O?
recrystallisation of sodium carbonate gives na2co3.10h2o It is known as sodium carbonate decahydrate.
What colour does sodium carbonate go?
Pure sodium carbonate is white.
What is the salt present in washing soda?
sodium carbonate
Why is sodium hydrogen carbonate in baking powder?
Sodium hydrogen carbonate is baking powder.
What is the product of sodium hydrogen carbonate and nitric acid?
Sodium hydrogen carbonate and nitric acid react to form sodium nitrate, carbon dioxide, and water.
Nitric acid plus sodium hydrogen carbonate?
Sodium Hydrogen Carbonate plus Nitric acid = Sodium Nitrate + Hydrogen + Co2
Formula for nitric acid plus sodium carbonate?
2 HNO3 + Na2CO3 ---> H2CO3 + 2 NaNO3 Nitric acid + sodium carbonate ---> carbonic acid + sodium nitrate
Why does only dilute nitric acid react with dry sodium carbonate?
When sodium bicarbonate reacts with nitric acid, sodium nitrate salt is formed along with carbonic acid (double replacement reaction), which immediately decomposes to water and gaseous carbon dioxide (which explains the fizzing). The concentration of the nitric acid affects the rate of reaction, the more dilute it is, the slower the reaction will progress. The more pure the nitric acid, the faster the reaction will take place.
What is NHO3?
sodium bi carbonate
How to balance the reaction between sodium hydrogen carbonate and sodium chloride?
Na2CO3 + CaCl2 >> CaCO3 + 2 NaCl ( double replacement)
What is the Name of the salt produced if sodium carbonate reacts with dilute nitric acid?
Sodium Nitrate?
What are the products of nitric acid and sodium carbonate?
the equation isCa + HNO3 ----> Ca(NO3)2 + H2 reactants products
What salt is produced if sodium carbonate reacts with dilute nitric acid?
Dilute Nitric acid when reacted with Sodium hydroxide will produce Sodium nitrate and Water. NaOH + HNO3 = NaNO3 + H2O.
Reaction of nitric acid with sodium carbonate?
Na2CO3+2(HNO3)=2(NaNO3)+H20+CO2
What does sodium carbonate and nitric acid make?
Sodium carbonate (Na2CO3) and nitric acid (HNO3) make sodium nitrate (NaNO3), water (H2O) and carbon dioxide (CO2).
What happens when Copper chloride and sodium carbonate mix?
They will react to form aqueous sodium chloride and solid copper carbonate in a double replacement reaction, also known as a double displacement reaction. CuCl2(aq) + Na2CO3(aq) --> CuCO3(s) + 2NaCl(aq)
