0
Na2CO3+2(HNO3)=2(NaNO3)+H20+CO2
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Formula for nitric acid plus sodium carbonate?
2 HNO3 + Na2CO3 ---> H2CO3 + 2 NaNO3 Nitric acid + sodium carbonate ---> carbonic acid + sodium nitrate
What is the product of sodium hydrogen carbonate and nitric acid?
Sodium hydrogen carbonate and nitric acid react to form sodium nitrate, carbon dioxide, and water.
Nitric acid plus sodium hydrogen carbonate?
Sodium Hydrogen Carbonate plus Nitric acid = Sodium Nitrate + Hydrogen + Co2
Why does only dilute nitric acid react with dry sodium carbonate?
When sodium bicarbonate reacts with nitric acid, sodium nitrate salt is formed along with carbonic acid (double replacement reaction), which immediately decomposes to water and gaseous carbon dioxide (which explains the fizzing). The concentration of the nitric acid affects the rate of reaction, the more dilute it is, the slower the reaction will progress. The more pure the nitric acid, the faster the reaction will take place.
What is the balance chemical equation for the reaction of Sodium Hydrogen carbonate and Nitric acid?
NaHCO3 + HNO3 = CO2 + H2O + NaNO3
Formula for nitric acid plus sodium carbonate?
2 HNO3 + Na2CO3 ---> H2CO3 + 2 NaNO3 Nitric acid + sodium carbonate ---> carbonic acid + sodium nitrate
What is the product of sodium hydrogen carbonate and nitric acid?
Sodium hydrogen carbonate and nitric acid react to form sodium nitrate, carbon dioxide, and water.
Nitric acid plus sodium hydrogen carbonate?
Sodium Hydrogen Carbonate plus Nitric acid = Sodium Nitrate + Hydrogen + Co2
Why does only dilute nitric acid react with dry sodium carbonate?
When sodium bicarbonate reacts with nitric acid, sodium nitrate salt is formed along with carbonic acid (double replacement reaction), which immediately decomposes to water and gaseous carbon dioxide (which explains the fizzing). The concentration of the nitric acid affects the rate of reaction, the more dilute it is, the slower the reaction will progress. The more pure the nitric acid, the faster the reaction will take place.
What is the balance chemical equation for the reaction of Sodium Hydrogen carbonate and Nitric acid?
NaHCO3 + HNO3 = CO2 + H2O + NaNO3
What is NHO3?
sodium bi carbonate
What kind of reaction is nitric acid and potassium carbonate is?
This is considered an acid/base reaction.
What are the products of nitric acid and sodium carbonate?
the equation isCa + HNO3 ----> Ca(NO3)2 + H2 reactants products
What is the double replacement for sodium carbonate plus nitric acid?
The chemical reaction is:Na2CO3 + 2 HNO3 = 2 NaNO3 + CO2 + H2O
What is the Name of the salt produced if sodium carbonate reacts with dilute nitric acid?
Sodium Nitrate?
What are the products of reaction between nitric acid and zinc carbonate?
cheese
What is the chemical reaction between chromic acid and sodium carbonate?
chromic acid + sodium carbonate -> sodium chromate + water + Carbon Dioxide
