0
This is considered an acid/base reaction.
Wiki User
∙ 6y ago
Wiki User
∙ 16y agoNeutrailsation Reaction
Add your answer:
Earn +20 pts
What is Potassium carbonate Litric Acid?
K2CO3 + 2HNO3 = 2KNO3 (potassium nitrate) + H2O + CO2 and it's nitric acid
What do you add to potassium hydroxide to get potassium nitrate?
You would add either ammonium nitrate or nitric acid.
What is the double replacement for sodium carbonate plus nitric acid?
The chemical reaction is:Na2CO3 + 2 HNO3 = 2 NaNO3 + CO2 + H2O
What is lead ii carbonate plus nitric acid?
The reaction is:Pb(CO3)2 + 2 HNO3 = Pb(NO3)2 + 2 CO2 + H2O
What is the general reaction for an acid and a carbonate?
The general reaction is Acid + Metal Carbonate -> Salt + Carbon Dioxide + Water Hope this helps!
What is the reaction equation of nitric acid with potassium carbonate?
2HNO3 + K2CO3 = 2KNO3 + H2O + CO2 Remember the general equations for acid and carbonate. Acid + Carbonate = Salt + Water + Carbon Dioxide. NB Other general equations for acid reactions are Acid + Base = Salt + Water Acid + Alkali = Salt + Water Acid + Metal = Salt + Hydrogen.
What is Potassium carbonate Litric Acid?
K2CO3 + 2HNO3 = 2KNO3 (potassium nitrate) + H2O + CO2 and it's nitric acid
What is the balanced chemical equation of potassium carbonate plus nitric acid?
iron :)
What when a reaction has taken place give you Potassium Nitrate plus Carbon dioxide plus water?
Potassium carbonate plus nitric acid. K2CO3 + 2HNO3 = 2KNO3 + H2O + CO2 .
What are the products of reaction between nitric acid and zinc carbonate?
cheese
What is the reaction of potassium carbonate and hydrochloric acid?
Chuck Norris
What reaction happens when nitric acid and calcium carbonate are mixed?
this produces carbon dioxide
What is the name of the salt that is formed by nitric acid and calcium carbonate?
This reaction will form calcium nitrate.
Reaction of nitric acid with sodium carbonate?
Na2CO3+2(HNO3)=2(NaNO3)+H20+CO2
What is the complete ionic equation for potassium carbonate reacting with hydrochloric acid?
total ionic equation (also known as the complete ionic equation) for the reaction of potassium carbonate with hydrochloric acid
Symbol equation for potassium hydroxide and nitric acid?
potassium hydroxide is POH and nitric acid is HNO3
What is the reaction of nitric acid with potassium hydroxide to form potassium nitrate with water?
The stated reaction is an example of a neutralization reaction between an acid and a base forming a product salt and water. The equation of the reaction is HNO3 + KOH -> KNO3 + H2O.
