0
Assuming the hydrocarbon is saturated the formula would be C21H44 In a saturated hydrocarbon the number of hydrogen atoms is equal to twice the number of carbon atoms, plus two.
Wiki User
∙ 12y ago
Wiki User
∙ 15y ago20C
Add your answer:
Earn +20 pts
How many protons are in C6H8O6?
The molecular formula C6H8O6 contain 20 atoms.
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
Are all the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
How many Hydrogen atoms are in an Alkane with 7 Carbon atoms?
Alkanes have the general formula of CnH2n+2 so for 12 carbons, that would be 2x12 + 2 = 26 hydrogen atoms.
What is the length range of a triglycerides?
16, 18 and 20 carbons are the most common.
How many protons are in C6H8O6?
The molecular formula C6H8O6 contain 20 atoms.
What is phenolphthalein molecular weight?
It has the molecular formula C20 H14 O4. Thus its Mr is (12*20+1*14+16*4) or 318.
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
The formula of 20 moles of sodium chloride?
The chemical formula of sodium chloride is NaCl; formula is not dependent from the number of moles. Because the molecular mass of NaCl is 57,958 622 382, the mass of 20 moles is 1159,172 447 64.
Are the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
Are all the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
What is the length range of a triglycerides?
16, 18 and 20 carbons are the most common.
How many Hydrogen atoms are in an Alkane with 7 Carbon atoms?
Alkanes have the general formula of CnH2n+2 so for 12 carbons, that would be 2x12 + 2 = 26 hydrogen atoms.
How do you calculate the molecular formula of a substance which contain 80 percent C and 20 percent H?
You can only calculate the empirical formula because you do not have a mass of this compound given. To do the empirical formula assume 100 grams and change percent to grams. Get moles. 80 grams Carbon (1 mole C/12.01 grams) = 6.66 moles C 20 grams hydrogen (1 mole H/1.008 grams) = 19.84 moles H the smallest becomes 1 in the empirical formula and the other number is divided by it, Thus; H/C 19.84 moles H/6.66 moles C = 2.9, which we call 3 so, CH3 --------------- is the empirical formula To get the molecular formula tour question needed to read; How to calculate molecular formula from such ans such mass of compound with these percentages of elements, Which, of course, your question did not provide. Then you would have divided that given mass by the mass total of the elements of the empirical formula, got a whole number by which you would have multiplied the numbers of your empirical formula to get molecular formula.
What is the molecular formula for turpentine?
Turpentine is a mixture of hydrocarbons just like kerosene oil it contains hydrocarbons having carbon atoms 11 to 20 or more
How many carbons are in dna?
That depends on how big your DNA is. Given that there are 10 carbons each per adenosine, guanosine, and thymidine and 9 carbons per cytidine.... which means there are 20 carbons per A-T basepair, and 19 carbons per G-C basepair... assuming the genome is 50% GC, that would mean an average of 19.5 carbons per base pair. The human genome is roughly 3 billion basepairs long... so I'd estimate in round numbers that there are about 58.5 billion carbon atoms in the genomic DNA of a single human cell.
I need an example of two household hydrocarbons?
Fuel oil (20-30 carbons in each chain) used in centeral heating etc. LPG (1-4 carbons in each chain) used in calor gas
