0
Right Hand dominant
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
What is change in scientific terms?
A SCIENTIFIC TERM CHANGE is bad
What is the scientific term for ghost?
Ghosts are not actually the subject of scientific inquiry, although some "ghost-hunters" like to pretend that they are. There are a number of synonyms for ghost, such as a phantom, specter, haunt, etc., but none of these is any more scientific than ghost.
What is the scientific term for magnetizing something?
zooming in
What is the scientific term for the ability to do work?
Energy.
What is the scientific term for water pressure?
hydrostatic pressure
What is the scientific term of mass and weight?
Mass and weight are perfectly scientific terms. It is not necessary to translate them into something more scientific.
What Scientific term for layers?
The scientific term is 'strata'.
What is the scientific term for plastics?
The scientific term for plastics is polymers.
What is the scientific term for ellipse?
That is precisely the scientific term: "ellipse".
What is the scientific term for diffusion?
molecular diffusion spreading more when in a larger area
What is the scientific term of hyperopia?
Hyperopia is the scientific term. The common term is far-sightedness.
What is the scientific term for mildew?
The scientific term for mildew is mold(mould)
What is the scientific term for hearing?
the scientific term for hearing loss is presbycusis
What is the scientific term for ophthalmologist?
Check your dictionary - ophthalmologist *is* a scientific term.
What is the scientific term for the application of knowledge of cooking and gastronomy?
If you are interested in scientific term for the application of knowledge of cooking and gastronomy, it is called molecular gastronomy. There are many websites that have more information such as Wikipedia.
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
What is the right term for rat's skin?
Skin is the correct term. For a more scientific sounding term, epidermis can be used. It refers to the outermost layer of the skin.
