0
What else can I help you with?
What is zoisite?
Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).
What is the scientific name of aquamarine?
The scientific name of aquamarine is Beryl, specifically a blue variety of the mineral beryl.
What is zoisite used for?
Bull sheit
How do you pronounce zoisite?
Zo-ee-syte
Is ruby zoisite metamorphic igneous or sedimentary?
metamorphic
Is ching a Chinese name?
"Ching" is not a commonly used Chinese name on its own. It could be a part of a longer Chinese name or a variation of a common Chinese name like Qing or Jing.
What does the Chinese name Sinh mean?
The Chinese name Sinh does not have a specific meaning in Chinese. It may be a variation or misspelling of a Chinese name or word.
What does the name kimberley in Chinese?
what does the name kimberley mean in chinese?
Where you can get a Chinese name?
You can choose a Chinese name from Here! I have choosen from this website! http://www.echineselearning.com/resources/get-a-chinese-name/index.html
What should i name my Chinese fish?
You should name your Chinese fish Martha or in Chinese maratharatia!
What chemical is in tanzanite?
Tanzanite is the blue/purple variety of the mineral zoisite, its chemical formula is :- (Ca2Al3(SiO4)(Si2O7)O(OH)).
What is the Chinese name for the fruit passion?
Xifanlian is sthe name in Chinese.
