0
What else can I help you with?
What is zoisite?
Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).
How do you pronounce zoisite?
Zo-ee-syte
What is the name of zoisite in Chinese?
黝帘石
Is ruby zoisite metamorphic igneous or sedimentary?
metamorphic
What chemical is in tanzanite?
Tanzanite is the blue/purple variety of the mineral zoisite, its chemical formula is :- (Ca2Al3(SiO4)(Si2O7)O(OH)).
What are four important uses for Zoisite?
I only have 3 and they are mineral specimens, omamental stone, and gemstones
What is an anyolite?
An anyolite is a metamorphic rock composed of intergrown green zoisite, black tschermakite, and ruby.
Are tanzanites supposed to be blue or purple?
Tanzanite is a variety of mineral zoisite that can be either blue or purple.
What is the scientific name of aquamarine?
The scientific name of aquamarine is Beryl, specifically a blue variety of the mineral beryl.
Is zoisite from sailor moon a girl or boy?
Zoicite is a boy in the Japanese anime version, English manga version, and a girl in the English dubbed anime version.
Is sailor moon evil?
No. There is an episode where Zoisite dresses up as sailor moon, and stabs tuxedo mask and a small side manga that has some goddess dress up as sailor moon to capture people.
What are some seven letter words with 1st letter Z and 3rd letter I and 7th letter E?
According to SOWPODS (the combination of Scrabble dictionaries used around the world) there are 1 words with the pattern Z-I---E. That is, seven letter words with 1st letter Z and 3rd letter I and 7th letter E. In alphabetical order, they are: zoisite
