0
What else can I help you with?
What is the equation reaction of 2-iodohexane with sodium methoxide?
The reaction between 2-iodohexane and sodium methoxide will result in an SN2 substitution reaction. The equation can be represented as: 2-iodohexane + Sodium methoxide → Hexane + Sodium iodide + Methanol
What is the equation of 2 iodohexane with sodium methoxide?
The reaction between 2-iodohexane and sodium methoxide will result in the substitution of the iodine atom by the methoxy group. The product formed will be 2-methoxyhexane. The equation for the reaction is 2-iodohexane + sodium methoxide -> 2-methoxyhexane + sodium iodide.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
Reaction between sodium hydroxide and methanol?
When sodium hydroxide reacts with methanol, a neutralization reaction occurs, forming sodium methoxide and water. The balanced chemical equation for this reaction is: CH3OH + NaOH → CH3ONa + H2O
What is the covalent bond in potassium methoxide?
In potassium methoxide, the covalent bond is between potassium and oxygen atoms in the methoxide ion (CH3O-), which is formed by the covalent bonding between carbon and oxygen atoms in the methoxide molecule. The potassium cation K+ is electrostatically attracted to the negatively charged oxygen atom in the methoxide ion, forming an ionic bond.
Bromocyclopentane plus methoxy what product?
The reaction between bromocyclopentane and methoxide will result in the substitution of bromine with the methoxy group, forming methoxycyclopentane as the product. This is a nucleophilic substitution reaction.
What is the reaction between an acidic and a basic solution called?
This is called a neutralization reaction.
What is the chemical equation for reaction between viscose solution and sulphuric acid?
write chemical equation for the reaction between viscose solution and sulphuric acid
What is the type of reaction between aqueous ammonia solution and an acid?
The reaction between aqueous ammonia solution and an acid is a neutralization reaction, where ammonia (a base) reacts with the acid to form an ammonium salt and water.
What is the reaction between and acidic and basic solution?
Neutralization
WHAT IS THE chemical equation for the reaction between viscose solution and sulphuric acid?
The reaction between viscose solution and sulfuric acid can be represented by the equation: cellulose (from viscose) + H2SO4 (sulfuric acid) → cellulose sulfate + H2O. This reaction can be used in the production of cellophane.
What is the name of the reaction between aqueous ammonia solution and an acid?
The reaction between aqueous ammonia solution and an acid is called neutralization. In this reaction, ammonia acts as a base and reacts with the acid to form a salt and water.
