0
What else can I help you with?
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is rection of 1-chlorobutane with sodium ethoxide?
The reaction of 1-chlorobutane with sodium ethoxide results in an SN2 reaction, leading to the substitution of the chlorine atom with an ethoxy group. This forms 1-butanol as the main product.
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
What is the word equation for sodium hydroxide?
Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water
How do you balance the equation for sodium and fluorine to produce sodium fluoride?
The balanced chemical equation for the reaction between sodium and fluorine to produce sodium fluoride is: 2 Na + F2 -> 2 NaF This equation is balanced because there are equal numbers of each type of atom on both the reactant and product sides of the equation.
What is the equation reaction of 2-iodohexane with sodium methoxide?
The reaction between 2-iodohexane and sodium methoxide will result in an SN2 substitution reaction. The equation can be represented as: 2-iodohexane + Sodium methoxide → Hexane + Sodium iodide + Methanol
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
2 iodohexane with sodium methoixde?
When 2-iodohexane is treated with sodium methoxide, a nucleophilic substitution reaction occurs. The sodium methoxide acts as a nucleophile attacking the carbon atom bearing the iodine, leading to the formation of hexanol and sodium iodide as byproduct. This reaction follows an SN2 mechanism due to the primary nature of the alkyl halide.
What is rection of 1-chlorobutane with sodium ethoxide?
The reaction of 1-chlorobutane with sodium ethoxide results in an SN2 reaction, leading to the substitution of the chlorine atom with an ethoxy group. This forms 1-butanol as the main product.
What is the balanced equation for sodium bromide from sodiumand bromine?
The balanced equation for the formation of sodium bromide from sodium and bromine is: 2 Na + Br2 → 2 NaBr
What is the balenced equation of dissolving sodium in water produces sodium oxide and hydrogen?
Sodium reacts with water to form sodium hydroxide and hydrogen. The balanced equation is 2Na + 2H2O --> 2NaOH + H2.
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
Why does the reaction of 2 2-dimethyloxirane with sodium methoxide in methanol gives primarily 1-methoxy-2-methyl-2-propanol?
Methoxide is your nucleophile; it will attack the C3 of 2,2-dimethyloxirane (the carbon that is attached to the oxygen, but doesn't have any methyl groups) via backside attack. This will cause the bond between C3 and the oxygen to break, thus releasing the chain and forming the oxide form of 1-methoxy-2-methyl-2-propanol. Since the oxide of this product is more basic than methanol, it will rip the hydrogen off of methanol, which will create the final product and regenerate methoxide.
What is the reaction equation for water and sodium carbonate?
The reaction equation for water and sodium carbonate is: Na2CO3 + H2O → 2 NaOH + CO2
What is the balanced equation between sodium fluoride and water?
Sodium fluoride dissolves in water but does not chemically react with water.
What is the word equation for sodium hydroxide?
Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water
What is the equatuion of sodium oxide?
The formula [not equation!] of sodium oxide is Na2O. A possible equation for forming it is 4 Na + O2 -> 2 Na2O.
