answersLogoWhite

0

When 2-iodohexane is treated with sodium methoxide, a nucleophilic substitution reaction occurs. The sodium methoxide acts as a nucleophile attacking the carbon atom bearing the iodine, leading to the formation of hexanol and sodium iodide as byproduct. This reaction follows an S­N2 mechanism due to the primary nature of the alkyl halide.

User Avatar

AnswerBot

1y ago

What else can I help you with?

Related Questions

What is the equation of 2 iodohexane with sodium methoixde?

CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI


What is the equation reaction of 2-iodohexane with sodium methoxide?

The reaction between 2-iodohexane and sodium methoxide will result in an SN2 substitution reaction. The equation can be represented as: 2-iodohexane + Sodium methoxide → Hexane + Sodium iodide + Methanol


What is the equation of 2 iodohexane with sodium methoxide?

The reaction between 2-iodohexane and sodium methoxide will result in the substitution of the iodine atom by the methoxy group. The product formed will be 2-methoxyhexane. The equation for the reaction is 2-iodohexane + sodium methoxide -> 2-methoxyhexane + sodium iodide.


Predict the two most likely mechanisms which occur when 2-iodohexane is heated in ethanol?

The most likely mechanisms when heating 2-iodohexane in ethanol are E2 elimination and substitution reactions. In the E2 elimination reaction, the iodine atom is eliminated along with a beta proton to form a double bond. In the substitution reaction, ethanol can act as a nucleophile and displace the iodine atom to form ethyl hexane.


What is the ratio of elements in sodium oxide?

The ratio of sodium to oxygen elements in sodium oxide is 2:1. This means that for every 2 atoms of sodium, there is 1 atom of oxygen in the compound.


How does water dissolve sodium?

Water doesn't dissolve sodium, water react violently with sodium:2 Na + 2 H2O = 2 NaOH + H2


What is the valency of sodium sulphate?

The valency of sodium in sodium sulfate is +1, while the valency of sulfate is -2. Therefore, the valency of sodium sulfate as a whole is +2.


Reaction of2-chloro2-methyl propane with sodium metal?

The reaction of 2-chloro-2-methylpropane with sodium metal results in a nucleophilic substitution reaction where the sodium displaces the chlorine atom, forming sodium chloride and 2-methylpropane. This process involves the formation of a new C-C bond and conversion of sodium to sodium chloride.


Why does 1-chlorohexane have a higher boiling point than 1-iodohexane?

You question is factually incorrect, 1-chlorohexane has a LOWER boiling point (135.1℃) than 1-iodohexane boiling point (181℃).The boiling point is affected by the fact that Iodine is a heavier atom than Chlorine, it takes more energy to get it to vaporize when in an otherwise equivalent compound.


What is the ratio pf sodium from sodium carbonate?

Sodium Carbonate (Na2CO3) has a ratio of 2 Sodium atoms to 1 Carbon atom, to 3 Oxygen atoms; Na:C:O 2 : 1 : 3


What does sodium hydroxide and sodium sulfate react to form?

Sodium hydroxide and sodium sulfate don't actually react.


What is the daily sodium intake for an average teenager?

From 2 g to 5 g sodium chloride (approx. 1-2 g sodium).