0
This does not exist as prop means 3, and you cannot have a triple bond on the 3rd carbon to another carbon if it is not there. I'll link 2 methyl 3 butyne as it is hard to explain. However, I'm pretty sure under IUPAC, it should be named 3 methyl 1 butyne at that.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What structure comes from hydroboration-oxidation of 2-methylpropene?
2-methyl-1-proponal
What is the chemical formula of strawberry extract?
(2S,3R)-ethyl 3-methyl-3-phenyloxirane-2-carboxylate
What is the formula for red 40?
Red 40 is disodium 6-hydroxy-5-((2-methoxy-5-methyl-4-sulfophenyl)azo)-2-naphthalenesulfonate with the chemical formula C18H14N2Na2O8S2.
How do you prepare methyl 2 methyl butyrate?
Methyl-2-methyl butyrate is CH3-CH2-CH(CH3)-COOCH3, it may be prepared by reacting 2-methyl butyric acid with methanol in presence of sulphuric acid.
Why concentrated acid is used in dehydration of 2-methyl-2-butanol?
2-methyl-2-butene is the major product (85%), while 2-methyl-1-butene the minor (15%) in an E1 reaction.
What is the chemical formula for 2-methyl-2-butanol?
The chemical formula of 2-methyl-2-butanol is C15H12O.
What is the mistake in the iupac name of 2 methyl 3 propyne?
The 3 in front of the propyne means that the triple bond is between the 3rd and 4th carbon of the longest carbon chain in the molecule. However, you only have 3 carbons in a chain.
What structure is obtained by hydroboration-oxidation of 2-methyl propene?
2 methyl 1 propanol
Isomer of ketone with formula C5H10O?
2-hexanone3-hexanone2-methyl-3-pentanone3-methyl-2-pentanone4-methyl-2-pentanone3,3-dimethyl-2-butanone
What is the molecular formula for 2-methyl-1-propanol?
C4h10o
What structure comes from hydroboration-oxidation of 2-methylpropene?
2-methyl-1-proponal
Structural formula of 3-chloro 2-methyl 1-butanol?
A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.
How many different isomers are possible for hydrocarbon with the molecular formula C4H10?
The alcohols having the formula C4H10O are four 1-butanol , 2-butanol, 2-methyl-1-propanol and 2-methyl-2-propanol.
How do you write the molecular formula for 2-methyl-1-butanol?
C5H12o
How many number of pi bond in propyne?
there are 2 pi bonds and 1 sigma bond in propyne (alkynes)
How do you distinguish 2-methyl-3-nitrobenzoic acid from3-methyl-2-nitrobenzoic acid?
Looking at the structure, the methyl group is closer to the carboxylic acid group on2-methyl-3-nitrobenzoic acid, while the nitro group is closer to the carboxylic acid group on 3-methyl-2-nitrobenzoic acid.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
