0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the gas state of water in two words?
Dihydrogen Monoxide.
What is one way you you can change water vapor from a gas to a liquid?
Cool it. If the water vapor is contained, copper coils are commonly used. In the cloud sense, water vapor is cooled as it rises, like when encountering a mountain range.
Is water vapor a mixture or pure substance?
Water vapor is a gas, not a mixture. Water vapor is just the gas form of water, it is not a mixture.Water Vapor is a compound made by bonding Hydrogen and Oxygen.
Is water vapor a compound or an element?
water vapor is a compound.
The gaseous phase of water is called?
Water cannot exist in gaseous state - water vapour is small droplets of water suspended in air, not water as a gas
What pollutant is associated with the breakdown of atmospheric ozone?
Water vapor, CFCs.
The major greenhouse gases include methane CFCs water vapor and?
Carbon Dixide
The major greenhouse gases include methane CFCs water vapor and what?
Carbon Dioxide.
What are the causes of the thinning ozone?
Ozone depleting substances, such as water vapor, CFCs (both natural and manmade), and more.
What are some of the causes of ozone depletion?
Ozone depleting substances, such as water vapor, CFCs (both natural and manmade), and more.
Can rain demolish CFCs?
CFCs are neither soluble in water or reactive with it. Rain has no impact on CFCs
What factor has contributed to the thinning of the ozone layer?
Refrigeration (Production of CFCs). Home hair care (Production of CFCs). Powered flight (Release of water vapor at high altitude, and consumption of oxygen at high altitude). Fossil fuel power (Release of hot water vapor to the atmosphere, reduction in free oxygen).
How many types of green house gas are there?
The Greenhouse gases are: * water vapor * carbon dioxide * methane * nitrous oxide * ozone * CFCs
What are 5 substances found in air?
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
How are cfcs used in aerosol?
CFCs were the compressed gas that was used as "spring" to push the can contents out of the container. CFCs have been replaced with HCFCs as a consequence of the Montreal Protocol.
What is harming the ozone layer?
This has been answered under other categories: # Water vapor both blocks one path of ozone formation, and provides a faster decay path for ozone. Water vapor arrives in the "ozone layer" from both natural and Man-caused sources. # CFCs have been shown to catalytically destroy ozone, and stick around long enough to do it again and again. CFCs are entirely Man-caused. Other catalysts may source from volcanos, etc.
What tools are used to measure water vapor?
hygrometer
