0
What substances has the largest surface tension CO2 SO2 H2O CH4?
Wiki User
∙ 9y ago
H2O since it is a liquid.
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
What two substances make up methane hydrate?
Methane hydrate is a combination of methane (CH4) and water (H2O).
What are 5 substances found in air?
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
Why is CH4 insoluble?
CH4 is not polar.So it is in soluble in polar compounds
What does the element ch4 contain?
Ch4 is not an element, it's the compound Methane
In CH4 - is 4 a catalyst?
CH4 is the chemical formula of methane; 4 is the number of carbon atoms.
Which has greater surface tension of CH4 H2O H2S and Hg?
This liquid is mercury: 484 dyn/cm.
Are most substances elements?
All substances are MADE FROM elements but they are not elements. For example CH4 is made of one carbon atom and four Hydrogen atoms. Carbon and Hydrogen are pure elements but CH4 is not an element.
What two substances are reacting when a Bunsen Burner is ignited?
The substances of methane (CH4), also known as natural gas, and air (O2) mix to start a Bunsen Burner.
What two substances make up methane hydrate?
Methane hydrate is a combination of methane (CH4) and water (H2O).
How many moles of CH4 are in 200 grams of CH4?
200 g CH4 x 1 mole CH4/16 g = 12.5 moles CH4
What are substances that provide energy as the result of a chemical change?
These substances are called reactants, the reaction produces products. This type of reaction is called exothermic. As in the following reaction with the burning of methane: CH4 +2O2 ---> CO2 + 2H2O (reactants) (products)
What is the name of the substance when you have ch4 plus 2o2 equals co2 plus 2h2o plus heat?
Methane, oxygen, carbon dioxide and water are the four substances.
What is the chemical formule for methane gas?
Methane is CH4
Why is CH4 polar?
the CH4 poler
Does The element with the largest subscript in a formula have the largest percent by mass in the compound?
Sometimes, but not necessarily: The largest percent by mass in a compound is that of the element for which the product of the subscript and the atomic weight is highest. For example, there is more carbon than hydrogen by mass in CH4.
Is ch4 molecule polar?
No. CH4 is nonpolar.
Is ch4 a Atom or Molecule?
ch4 is an atom.
