0
Ozone is not a threat to humans at atmosphere. It is something which protects us from UV radiations.
Wiki User
∙ 8y ago
Add your answer:
Earn +20 pts
What can be done to stop cows from destroying ozone layer?
Cows don't fly airplanes, so cows are no threat to the ozone layer. another answer: Cattle and other ruminant animals belch methane. This is a greenhouse gas which contributes to global warming. It does not have a major role in damaging the ozone layer.
What are some hazards to the ozone layer?
The man-made gases of CFCs (chlorofluorocarbons). Chlorines and bromines from these gases stay in the atmosphere for years, destroying ozone molecules. This allows the sun's dangerous ultra violet (UV) radiation to reach earth, causing human cancers and damage to crops.
How has the government been trying to prevent ozone depletion?
The government has done many things to save ozone. Banning CFC's, depleting CFC's etc.
Why is the ozone layer comparatively thinner in antarctica than the rest of the world?
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world. 1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica. 2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
What is the most serious threat to human health of a decrease in the atmospheric ozone?
If the ozone layer is reduced, more UV rays will reach the earth. As additional UV rays reach the earth, human DNA and cells can be damaged, leading to more skin cancer and eye cataracts.
What substance is a major threat to the ozone layer?
CFC's are a major threat to ozone. They react with ozone to deplete it.
Why is the ozone layer under threat?
The ozone layer is under threat due to the continues use of CFCs. These CFC react with ozone and cause a number of problems.
Why is damage to the ozone layer such a treat to many organisms?
Damage to ozone is a threat. It is because it causes the ever damaging UV to enter.
What problem does a hole in the ozone cause for humans and other organisms?
A hole in the ozone is a big threat. It can cause humans and other organisms to extinct.
Is nitrous oxide the main ozone threat?
No. Nitrous oxide is the "dead body" of what could have been an ozone molecule, if water vapor had not gotten to the excited and unstable nitrogen and oxygen "free radical" first. The main threat is water vapor in that case.
Who studied ozone?
Mario J. Molina, a Mexican scientist, won the Nobel Prize in 1995 (along with Paul J. Crutzen and F. Sherwood Rowland) for studies of the ozone layer and the threat from CFCs (chlorofluorocarbons).
What can be done to stop cows from destroying ozone layer?
Cows don't fly airplanes, so cows are no threat to the ozone layer. another answer: Cattle and other ruminant animals belch methane. This is a greenhouse gas which contributes to global warming. It does not have a major role in damaging the ozone layer.
What are some hazards to the ozone layer?
The man-made gases of CFCs (chlorofluorocarbons). Chlorines and bromines from these gases stay in the atmosphere for years, destroying ozone molecules. This allows the sun's dangerous ultra violet (UV) radiation to reach earth, causing human cancers and damage to crops.
How has the government been trying to prevent ozone depletion?
The government has done many things to save ozone. Banning CFC's, depleting CFC's etc.
Why is the ozone layer comparatively thinner in antarctica than the rest of the world?
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world. 1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica. 2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
What is the most serious threat to human health of a decrease in the atmospheric ozone?
If the ozone layer is reduced, more UV rays will reach the earth. As additional UV rays reach the earth, human DNA and cells can be damaged, leading to more skin cancer and eye cataracts.
How is ozone in the stratosphere the same as the troposphere?
No. The ozone is stratosphere is good ozone. The ozone in troposphere is bad ozone.
