When did Italians begin coming to Texas?

Anonymous

∙ 15y ago

Updated: 8/17/2019

They started migrating into Texas in the mid to late 1800's. The Russian and Italian mafia were competing for righteousness to the public and control over the state. Don Corleone started pwning everyone.

Fin.

Wiki User

∙ 15y ago

What else can I help you with?

Where did the Italian immigrants live in Texas?

in Houston san antonio Galveston and the brazos river valley

How did the Italians get to Texas?

They flew

Where did Italians live in Texas?

live in central texas

Do Italians migrate to Texas?

Of course, everyone wants to come to Texas! :)

Are there any Italian coming of age celebrations?

Italians celebrate their 18th birthday as a coming of age.

How far did Italians have to to go to get to Texas in the early 1900s?

By Boat, Ship or plane

Why did the Italians come to Texas?

Italians came to Texas because of low wages and high taxes. Not to mention the war going on in Europe.

How many miles do Italians have to go to get to Texas?

i'd say approximately 3,500 miles :)

Why do Italians wish to see the Colosseum?

Not just italians, my friend, we have alot of tourist coming to the the Colosseum, it was made to give satisfaction to people a very long time ago

When is trader joe's coming to Texas?

A trader joe's representative said they have no plans on coming to Texas :(

Is Selena Gomez coming to Texas?

she lives in texas

Where does sao paulo population get their from?

In the Begin , Portuguese , After Italians , and 100 Years after Japanese and now all people of the world

Trending Questions

What is an electrostatic force? How old is lala brown's daughter? What is the value of a Browning 25 auto vest pocket or baby browning? Is Check a noun? What are the names of the autobots? How many cups are in a peeled and cored peck of pears? What is the Alien called in the Alien movies? What do you round 3.17 to? Where is the coolant temperature sensor in a 1994 dodge ram van B 350? Is rice is high in uric acid? What are the names of all of the beach boys albums? What are symptoms of schizophrenia in dogs? How much do a shark eat in a day? Can a triangle be drawn with more than one acute angle? Examples of situation in decision making? Why did the Enlightenment thinkers think it was important to understand the universe? What is sap sdn and what does it stand for? How can I effectively whitewash a brick fireplace? When did Vyacheslav Molotov die? What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?