0
because the oxidation state of N decreases
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
How many atoms in AL(NO3)3?
its Al + NO3 + NO3 + NO3. So one Al, three N and nine O. That makes 13 atoms.
What is the formula for zinc nitride?
The chemical formula for zinc nitrate is Zn(No3)2
How do you bond CA 2 WITH NO3 1- in chemistry?
We need two NO3- to cancel out Na2+: Ca(NO3)2.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
How many atoms in AL(NO3)3?
its Al + NO3 + NO3 + NO3. So one Al, three N and nine O. That makes 13 atoms.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the formula for zinc nitride?
The chemical formula for zinc nitrate is Zn(No3)2
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is ionic character of NO3?
The ionic character of NO3 is -1.
How do you bond CA 2 WITH NO3 1- in chemistry?
We need two NO3- to cancel out Na2+: Ca(NO3)2.
Does BaCl2 and Mg NO3 2 form a precipitate?
Yes it does. BaCl2+Mg(NO3)2--->Ba(NO3)2+MgCl2
Is NO3 a covalent bond?
NO3 is a nitrate ion. Yes, the nitrogen and the oxygen atoms in NO3 are bonded together by covalent bonds.
