0
What else can I help you with?
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is the name and formula of the compound Pb4 and NO3-?
The compound is lead(IV) nitrate, with the formula Pb(NO3)4.
Formula for Ba2 plus and NO3-?
I believe that would be Barium nitrate or Ba(NO3)2
What is the standard electrode potential of Nitrate?
The standard electrode potential of nitrate (NO3-) is +0.96 V. This value is for the reduction half-reaction of nitrate to nitrite under standard conditions.
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is the substrate for nitrate reductase?
The substrate for nitrate reductase is nitrate (NO3-). Nitrate reductase catalyzes the reduction of nitrate to nitrite (NO2-) during the process of nitrate assimilation in plants and microorganisms.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
