0
Respiration means breathing. You're probably doing it now;-)
Respiration also has another meaning, though the two functions are connected closely.
Breathing (respiration) is a physical exchange of gases (oxygen and carbon dioxide).
The formula, however, is:
glucose + oxygen = carbon dioxide + water + energy.
Hope i helped! :)
What else can I help you with?
What do organisms need for aerobic cell respiration?
Organisms need oxygen, glucose, and mitochondria to carry out aerobic cell respiration. Oxygen is the final electron acceptor in the electron transport chain, glucose is the source of carbon and energy, and mitochondria are the organelles where aerobic respiration takes place.
What are the formulas for photosynthesis and cell respiration?
See the questions in the "Related Questions" section below for each individual equation.
What is the gross primary productivity formula used to calculate the amount of energy produced by plants through photosynthesis in an ecosystem?
The gross primary productivity formula is: Gross Primary Productivity Rate of Photosynthesis - Rate of Respiration. This formula calculates the amount of energy produced by plants through photosynthesis in an ecosystem.
Respiration with and without oxygen is called?
Aerobic respiration requires oxygen; anaerobic respiration does not use oxygen.
Formula for cell resperation?
This is the basic exact opposite of the equation for photosynthesis which is Photosynthesis---->6C O2 + 6H2 O + Sunlight = C6 H12 O6 + 6o2 Respiration-----> C6 H12 O6 + 6O2 = 6H2 O + 6C O2 + Energy
How does the cellular reperation formula relate to the photosynthisis formula?
The products of the cellular respiration formula are the reactants of the photosynthesis formula, and the reactants of the cellular respiration formula are the products of the photosynthesis formula. Basically, they are opposite processes.
What is the 36 ATP in the respiration formula?
energy
What is the formula for cellular anaerobic respiration?
The formula for cellular anaerobic respiration in human cells is: glucose → lactic acid + energy. This process occurs in the cytoplasm and does not require oxygen.
What is the anaerobic respiraton formula?
The formula for anaerobic respiration in humans is: glucose -> lactic acid + energy.
What is reversible formula for photosynthesis and respiration?
Photosynthesis Needs light energy, co2, and h2o. It gives off Glucose and o2. Respiration needs o2 and glucose. It gives of energy, o2, and h2o.
Which life process creates energy from glucose?
Respiration. Glucose is basically sugar, which is taken in by organisms that use respiration by eating food. That respiration and oxygen taken in from the mouth or nose, is used. Look at the formula for respiration! Hope this helped!
What are the reactants in the cellular respiration formula?
Reactants are glucose and oxygen.Products are CO2 and water.
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
What is the chemical formula and word formula for cell respiration?
Chemical formula: C6H12O6 + 6O2 -> 6CO2 + 6H2O + ATP Word formula: Glucose + Oxygen -> Carbon dioxide + Water + Energy (ATP)
How does reaction for photosynthesis compare to the cellular respiration?
they are they same. the products of photosynthesis are oxygen and glucose and the reactants of cellular respiration are gluose and oxygen.
How would Splenda affect respiration?
The chemical formula of Sucralose, which is found in Splenda and Equal, is C12H19Cl3O8. It has little to no effect on respiration as it is closely related to sugar and does not contain Aspartame.
Do photosynthesis and cellular respiration relate to each other?
Photosynthesis makes the energy(ATP), then the cellular respiration breaks it down to create food. The Formula is similar, but in opposite directions.
