C6 H12 O6 + 6 H20 + 6 CO2 + Energy
Organisms need oxygen, glucose, and mitochondria to carry out aerobic cell respiration. Oxygen is the final electron acceptor in the electron transport chain, glucose is the source of carbon and energy, and mitochondria are the organelles where aerobic respiration takes place.
See the questions in the "Related Questions" section below for each individual equation.
The gross primary productivity formula is: Gross Primary Productivity Rate of Photosynthesis - Rate of Respiration. This formula calculates the amount of energy produced by plants through photosynthesis in an ecosystem.
Aerobic respiration requires oxygen; anaerobic respiration does not use oxygen.
This is the basic exact opposite of the equation for photosynthesis which is Photosynthesis---->6C O2 + 6H2 O + Sunlight = C6 H12 O6 + 6o2 Respiration-----> C6 H12 O6 + 6O2 = 6H2 O + 6C O2 + Energy
The products of the cellular respiration formula are the reactants of the photosynthesis formula, and the reactants of the cellular respiration formula are the products of the photosynthesis formula. Basically, they are opposite processes.
energy
The formula for cellular anaerobic respiration in human cells is: glucose → lactic acid + energy. This process occurs in the cytoplasm and does not require oxygen.
The formula for anaerobic respiration in humans is: glucose -> lactic acid + energy.
Photosynthesis Needs light energy, co2, and h2o. It gives off Glucose and o2. Respiration needs o2 and glucose. It gives of energy, o2, and h2o.
Respiration. Glucose is basically sugar, which is taken in by organisms that use respiration by eating food. That respiration and oxygen taken in from the mouth or nose, is used. Look at the formula for respiration! Hope this helped!
Reactants are glucose and oxygen.Products are CO2 and water.
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
Chemical formula: C6H12O6 + 6O2 -> 6CO2 + 6H2O + ATP Word formula: Glucose + Oxygen -> Carbon dioxide + Water + Energy (ATP)
they are they same. the products of photosynthesis are oxygen and glucose and the reactants of cellular respiration are gluose and oxygen.
The chemical formula of Sucralose, which is found in Splenda and Equal, is C12H19Cl3O8. It has little to no effect on respiration as it is closely related to sugar and does not contain Aspartame.
Photosynthesis makes the energy(ATP), then the cellular respiration breaks it down to create food. The Formula is similar, but in opposite directions.