0
Do unsaturated fatty acids have low melting point than suturated?
ArjunKV
The double bonds in unsaturated fatty acids restrict movement. They are more "kinked" up and do not pack as tightly (think of crumpled/wadded up paper balls vs flat sheets of paper. the balls have a much larger volume per sheet, whereas the individual flat sheets stack together very nicely. ditto for unsaturated vs saturated fats). Saturated fatty acids have more freedom of movement and tend to pack together more. Ergo, unsaturated fats are generally liquid at room temp while saturated fats aren't, so yes, they do have a lower melting temp.
Wiki User
∙ 13y ago
Wiki User
∙ 9y agoYes. Unsaturated fatty acids have double and triple bonds along with their single bonds, meaning less places for hydrogens to bond to the carbons.
Add your answer:
Earn +20 pts
Are prostaglandins an inflammation polysaccharide?
No, they are unsaturated fatty acids.
Why do saturated fatty acid have straight structures while unsaturated fatty acid structure bend?
The bent structure in unsaturated fatty acids arises due to the presence of the double bonds.
Where you could find the standard Rf values for fatty acids and poly unsaturated fatty acids?
Rf value of oleic acid with solvent system
Unsaturated fatty acids don't pack together due to?
Graham Hughes
Write the structure of linolenic acid why is it an unsaturated fatty acid?
ch3ch2ch=chch2ch=chch2ch=ch(ch2)6cooh It's an unsaturated fatty acids because it has double bonds
Why is beef fat a solid at room temperature?
This is because it contains more saturated fatty acids then unsaturated fatty acids. Saturated fatty acids have a higher melting point then unsaturated fatty acids.
What are unsaturated fatty acids?
Unsaturated fatty acids are fatty acids that have double bonds in their long carbon chains.
Distinguish between saturated fatty acids and saturated fatty acids?
There is no difference between saturated fatty acids and saturated fatty acids. If you meant saturated fatty acids and UNsaturated fatty acids, then the unsaturated ones are the ones with double (or, theoretically, triple) bonds in the carbon chain.
Are saturated fatty acid good for the body?
No, unsaturated fatty acids are good for body. (PUFA is every better, poly unsaturated fatty acids)
What is the difference between a saturated an a unsaturated fatty acid?
Unsaturated fatty acids have double bond or triple bonds, whereas saturated fatty acids do not.
Liquid fats called oils contain?
it contains mostly unsaturated fatty acids it contains mostly unsaturated fatty acids
Unsaturated fatty acids that have changed to saturated fatty acids are called?
trans fat
Effect of double bond in fatty acids to its melting point?
double bonds mean the fatty acid is unsaturated and kinky which makes its packing difficult in the phospholipid bilayer and hence this drop the melting point
What are unsaturated fatty acids classified as?
lipids
Fatty acids with double bonds between carbons are described to be?
Fatty acids with double bonds between some of their carbons are referred to as unsaturated fatty acids. These fatty acids tend be remain in liquid form at room temperature.
What has the author Jacques David Richter written?
Jacques David Richter has written: 'High pressure hydrogenation of unsaturated fatty acids to unsaturated fatty alcohols' -- subject(s): Alcohols, Catalysts, Hydrogenation, Unsaturated fatty acids
What causes unsaturated fatty acids to have a different shape than saturated fatty acids?
The double chain in the unsaturated fatty acid cause it to bent; unlike saturated fatty acid which has no double bond, is straight
