0
When NaOH dissolves in water, it dissociates into Na+ and OH- ions. The equation representing this ionization reaction is: NaOH (s) → Na+ (aq) + OH- (aq).
If you want a chemical equation showing the complete dissociation of NaOH in water, it would be: NaOH (s) → Na+ (aq) + OH- (aq).
What else can I help you with?
What is the equation of sodium hydroxide with phenolphthalein with hydrochloric acid?
The equation for the reaction between sodium hydroxide (NaOH) and hydrochloric acid (HCl) using phenolphthalein indicator is: NaOH + HCl → NaCl + H2O Phenolphthalein is a pH indicator that turns pink in basic solutions and colorless in acidic solutions.
Which substances are reactants and which are products in this equation NaOH HCI H2O?
NaOH and HCl are the reactants; water and ammonium chloride are the products.
What is the reaction equation for water and sodium carbonate?
The reaction equation for water and sodium carbonate is: Na2CO3 + H2O → 2 NaOH + CO2
What is the complete ionic equation for NaOH?
The complete ionic equation for NaOH (sodium hydroxide) dissolved in water is: Na⁺ + OH⁻ + H₂O → Na⁺(aq) + OH⁻(aq).
Why unboiled water can be used to prepare acetic acid solutions but not a NaOH solution?
Unboiled water can be used for acetic acid solutions because acetic acid is a weak acid that will still dissolve adequately in the presence of impurities. On the other hand, unboiled water should not be used for NaOH solutions because NaOH is a strong base that will react with impurities in the water, affecting the concentration and pH of the solution. It is important to use distilled or deionized water when preparing NaOH solutions to ensure accuracy and consistency.
What is the equation of sodium hydroxide with phenolphthalein with hydrochloric acid?
The equation for the reaction between sodium hydroxide (NaOH) and hydrochloric acid (HCl) using phenolphthalein indicator is: NaOH + HCl → NaCl + H2O Phenolphthalein is a pH indicator that turns pink in basic solutions and colorless in acidic solutions.
Which substances are reactants and which are products in this equation NaOH HCI H2O?
NaOH and HCl are the reactants; water and ammonium chloride are the products.
What is the reaction equation for water and sodium carbonate?
The reaction equation for water and sodium carbonate is: Na2CO3 + H2O → 2 NaOH + CO2
What is the complete ionic equation for NaOH?
The complete ionic equation for NaOH (sodium hydroxide) dissolved in water is: Na⁺ + OH⁻ + H₂O → Na⁺(aq) + OH⁻(aq).
Why unboiled water can be used to prepare acetic acid solutions but not a NaOH solution?
Unboiled water can be used for acetic acid solutions because acetic acid is a weak acid that will still dissolve adequately in the presence of impurities. On the other hand, unboiled water should not be used for NaOH solutions because NaOH is a strong base that will react with impurities in the water, affecting the concentration and pH of the solution. It is important to use distilled or deionized water when preparing NaOH solutions to ensure accuracy and consistency.
What is the formula equation for hydrochloric acid sodium hydroxide-sodium chloride water?
This equation is HCl (aq) + NaOH (aq) -> NaCl (aq) + H2O.
What is the product and balanced equation of C8H5O4K NaOH?
The reaction between C8H5O4K and NaOH will produce potassium salicylate (C7H5KO3) and water. The balanced equation is: C8H5O4K + NaOH → C7H5KO3 + H2O.
What is the chemical equation for reaction of rennies tablets from SA HCL and NaOH?
The chemical equation for the reaction between hydrochloric acid (HCl) and sodium hydroxide (NaOH) to form sodium chloride (NaCl) and water (H2O) is: HCl + NaOH -> NaCl + H2O
What is the net ionic equation for Na OH plus water?
The net ionic equation for NaOH (sodium hydroxide) in water is: Na⁺ + OH⁻ → NaOH. This represents the dissociation of sodium ion and hydroxide ion to form sodium hydroxide in solution.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the balanced equation for C6H8O7H2O and NaOH?
The chemical equation is:C6H8O7 + 3 NaOH = C6H5O7Na3 + 3 H2O
What is the product of a reaction that take place when sodium oxide combines with water?
The reaction between sodium oxide (Na2O) and water (H2O) forms sodium hydroxide (NaOH). The chemical equation for this reaction is: Na2O + H2O -> 2NaOH
