0
Dry ice is not formed in this instance.Dry ice is solid carbon dioxide. The phenomenon involving sodium acetate is colloquially called hot ice. Simply adding sodium acetate to water will not produce this. You need to create a supersaturated solution. You add sodium acetate to water untill it cannot dissolve any more, and then cool the solution. Now you have an unstable solution that has more dissolved sodium acetate than it could normally hold. If it is disturbed, the sodium acetate will sponaneously crystallize.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What happens when sodium hydroxide is added to acetic acid?
sodium acetate and water are formed.
What are some strange facts about sodium acetate?
One fun fact about sodium acetate is that it can be added to food products for extra flavoring. Ironically, it is also used to seal concrete against water damage.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the trihydrate in sodium acetate as trihydrate crystals?
The term trihydrate refers to the fact that three molecules of water are associated with each formula unit of sodium acetate. The formula unit for sodium acetate trihydrate is NaC2H3O2‧3H2O.
Which product has the largest molecular mass sodium acetate water or carbon dioxide?
The molar mass of sodium acetate is 82,03. The molar mass of carbon dioxide is 44,01.
What happens when sodium hydroxide is added to acetic acid?
sodium acetate and water are formed.
Is sodium acetate soluble or insoluble in water?
Sodium acetate is soluble in water.
What is the name of the substance when sodium bicarbonate is added to acetic acid?
Sodium acetate, carbon dioxide and water are the products.
Name the solution formed when sodium is added to water?
sodium hydroxide solution
What are some strange facts about sodium acetate?
One fun fact about sodium acetate is that it can be added to food products for extra flavoring. Ironically, it is also used to seal concrete against water damage.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Is sodium acetate soluble in water?
yes
What do vinegar and baking soda create?
Carbon Dioxide, Water, and Sodium Acetate Sodium bicarbonate + acetic acid ---> sodium acetate + carbon dioxide + water (baking soda) (vinegar)
Is CuCO3 soluble in water?
Yes, NaCH3COO (sodium acetate) is soluble in water as are all sodium compounds.
What is the trihydrate in sodium acetate as trihydrate crystals?
The term trihydrate refers to the fact that three molecules of water are associated with each formula unit of sodium acetate. The formula unit for sodium acetate trihydrate is NaC2H3O2‧3H2O.
Is the reaction between Sodium acetate and water a chemical reaction?
No, it is simply the water dissolving the sodium acetate, which is a physical change. There is a physical change when you introduce a seed crystal to the sodium acetate as the bonds in the chemical become different to form a solid. By adding water, you are just dissolving it and then allowing it to become supersaturated through heating.
After mixing baking soda and vinegar we produce sodium acetate plus water plus carbon dioxide What state of matter is the sodium acetate at this point?
solid
