0
What else can I help you with?
How many hydrogen bonds are formed between C and G?
Three hydrogen bonds are formed between cytosine (C) and guanine (G) in DNA base pairing.
How many hydrogen bonds connect these two bases?
Two hydrogen bonds connect adenine and thymine.
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
How many atoms are in HBr?
There is one hydrogen atom and one bromine atom in one molecule of HBr.
How many elements are in the compound C6H12O6?
There are 3 elements in the compound C6H12O6: carbon (C), hydrogen (H), and oxygen (O).
How many kids does Jerome Adams have?
Jerome Adams has 3 children
How many children does Jerome Adams have?
Jerome Adams has 3 children
How many medals have valerie Adams won?
3
How many girls did Abigail Adams have?
she had 3 girls.
How many hydrogen and oxygen atoms in vinegar?
3 Hydrogen and 2 Oxygen
How many stable isotopes does Does Hydrogen have?
3
How many syllables in hydrogen?
3 syllables
How many hydrogen bonds does arsenic have?
3
How many hours did Thomas Jefferson die from john Adams?
3
How many lakeside world titles has Martin Adams won?
3
How many nucleons are in hydrogen 3?
In hydrogen-1 (1H isotope), there is only one proton. It has just the one nucleon. But there are a couple of other isotopes of hydrogen, and they are hydrogen-2 and hydrogen-3. In hydrogen-2, a neutron is bound to the proton, and in hydrogen-3, twoneutrons are bound to the proton. That gives hydrogen-2 twonucleons, and hydrogen-3 three nucleons. Hydrogen will have either one, two or three nucleons, depending on which isotope we are investigating.
How many hydrogen bonds are formed between C and G?
Three hydrogen bonds are formed between cytosine (C) and guanine (G) in DNA base pairing.
