A propyl group consists of 3 carbon atoms, so 3 propyl groups would have 9 carbon atoms. Each carbon atom is bonded to 3 hydrogen atoms in an alkane, so 3 propylheptane would have 27 hydrogen atoms in total.
Three hydrogen bonds are formed between cytosine (C) and guanine (G) in DNA base pairing.
Two hydrogen bonds connect adenine and thymine.
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
There are 3 elements in the compound C6H12O6: carbon (C), hydrogen (H), and oxygen (O).
There is one hydrogen atom and one bromine atom in one molecule of HBr.
Jerome Adams has 3 children
Jerome Adams has 3 children
3
she had 3 girls.
3 Hydrogen and 2 Oxygen
3
3
3 syllables
3
3
In hydrogen-1 (1H isotope), there is only one proton. It has just the one nucleon. But there are a couple of other isotopes of hydrogen, and they are hydrogen-2 and hydrogen-3. In hydrogen-2, a neutron is bound to the proton, and in hydrogen-3, twoneutrons are bound to the proton. That gives hydrogen-2 twonucleons, and hydrogen-3 three nucleons. Hydrogen will have either one, two or three nucleons, depending on which isotope we are investigating.
Three hydrogen bonds are formed between cytosine (C) and guanine (G) in DNA base pairing.