answersLogoWhite

0

Is CH3- polar

User Avatar

Anonymous

14y ago
Updated: 5/30/2024

No, CH3CH3, or ethane, is not polar. It is considered nonpolar because it does not have strongly charged negative or positive hydrogen or carbon atoms.

User Avatar

Alvah Stokes

Lvl 13
4y ago

What else can I help you with?

Related Questions

Is CH3 CH216 CO2H polar or nonpolar?

The compound known as CH3(CH2)16CO2H is typically considered polar. Its molecules are able to have dipole moments, and it is soluble in water.


Is CH3-CO-CH3 polar?

It is polar. The oxygen has 4 electron domains. 2 are occupied by a molecule of different electronegativity, and 2 are only occupied by electrons. (another molecule that has this similar is H2O witch is polar) CH3OCH3 is shaped with the Carbons and Hydrogens at one side, oxygen in the middle, and electrons on the other side. this causes the molecule to be polar.


Is CH3CN non polar?

No, CH3CN (acetonitrile) is a polar molecule. The carbon-nitrogen bond is polar due to the electronegativity difference between carbon and nitrogen. This creates a slight positive charge on carbon and a slight negative charge on nitrogen, resulting in a polar molecule.


Is lactic acid a polar or nonpolar molecule?

Lactic acid is a polar molecule. It contains both polar (-OH) and nonpolar (CH3) groups, but the presence of the polar -OH groups makes it an overall polar molecule.


C6H6 C2H5OH CH3CH2CH2OH CH3-O-CH3 Which compound has more repulsion with water and why?

C6H6 will be repelled the most. C2H5OH and CH3CH2CH2OH are both alcohols, both are polar molecules and will easily dissolve in water.CH3OCH3 is dimethyl ether and will repel water, though it is slightly polar.C6H6 or benzene will be repelled by water the most, as benzene is non polar and water is polar.


Does (ch3)2o have a dipole moment?

Yes, (CH3)2O (dimethyl ether) has a dipole moment because it contains polar bonds between oxygen and carbon, resulting in an overall dipole moment.


Is CH3 hydrophobic?

methyl is hydrophobic because it is non polar. the c-h bonds have little electronegativity difference I believe. water is polar, and nonpolar things don't tend to react or dissolve in polar substances.


Which is more polar phenol or ethanol?

Yes , phenol is more polar than toluene. because ph-OH has more dipole moment than Ph-CH3


What is the difference between alanine and glycine amino acids?

The -r group of alanine is -CH3 - which is a non-polar group, while the -r group of glycine is -H - which is an uncharged polar r group.


Is LSD a polar or non-polar molecule?

LSD (Lysergic acid diethylamide) is a polar molecule because it contains polar groups such as amide and diethylamide, which create an uneven distribution of electrical charge within the molecule. This allows it to interact with other polar molecules and substances in the body.


Is ch3ch(oh)ch3 more or less polar than water?

CH3CH(OH)CH3, or isopropanol, is less polar than water. While isopropanol contains a hydroxyl group (-OH) that can form hydrogen bonds, its overall molecular structure, including the presence of two hydrocarbon groups (methyl groups), reduces its polarity compared to water. Water's highly polar nature is due to its bent shape and strong hydrogen bonding capabilities, making it more polar than isopropanol.


What 2 4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane