0
What else can I help you with?
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is KB for ch3 3n aq h2o l ch3 3nh aq oh-aq?
Kb=[(Ch3)3 NH+][OH-] __________ [(Ch3)3 N]
What is the R group found in alanine?
The R group in alanine is a simple methyl group (CH3). This nonpolar, hydrophobic side chain is small and uncharged, making alanine a neutral, aliphatic amino acid.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
Cite examples of chemicals that contains carbon-carbon bonds?
ethane CH3-CH3 propane CH3-CH2-CH3 butane CH3-CH2-CH2-CH3 (all the above are alkanes, their are a lot of other types of hydrocarbons and carbon-carbon bonds)
