answersLogoWhite

0

No, CH3CH=CHCH2CH3 (2-pentene) is a hydrocarbon. Hydrocarbons are nonpolar.

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

How many isomers are there of c4h8?

There 4 isomers : 1) H2C=CHCH2CH3 => but-1-ene 2) CH3CH=CHCH3 => but-2-ene 3) (CH3)2C=CHCH3 => 2- methylpropene 4) CH2-CH2-CH2-CH2 => cyclobutane/cycloalkane. C4h8 has 3 isomers from the same homologous series and one that is not from the same homologous series.


Is adenine polar or non polar?

Alanine is an amphoteric substance: both acidic and basic at the same time. However, it is neutral in a pH = 6.1 solution: CH3CH(NH3+)COO- It is positvely charged ( by excess of H+) at lower pH sol'n CH3CH(NH3+)COOH and negatively in pure water or more basic solution CH3CH(NH2)COO-.


Is ch3ch(oh)ch3 more or less polar than water?

CH3CH(OH)CH3, or isopropanol, is less polar than water. While isopropanol contains a hydroxyl group (-OH) that can form hydrogen bonds, its overall molecular structure, including the presence of two hydrocarbon groups (methyl groups), reduces its polarity compared to water. Water's highly polar nature is due to its bent shape and strong hydrogen bonding capabilities, making it more polar than isopropanol.


What is the structural formula of 2-pentene?

H3C-CH=CBr-CH2-CH3A 5 carbon chain with a one double bond between the 2nd and 3rd carbon atoms, and a bromine bound to the third carbon in the chain. Implicit hydrogens filled up to 4 bonds per carbon.


What is ch3ch?

Many compounds have this formula; for example tert-butylamine.


What is the structure for 3-chlorobutanamide?

CH3CH(Cl)-CH2-CONH2


Sketch a polar curve for r equals sin theta?

It will be a circle.


What kind of reproduction do polar bears use?

polar bears reproduce sexually which mostly uses egg and sperm equals a baby


What is the chemical name for isopropyl alcohol?

Ch3ch(oh)ch3


What is name of ch3chch3ch2cho?

The name of the compound CH3CH(CH3)CH2CHO is 2-methylbutanal.


What is the name of the compound CH3CH(CH3)C(CH3)?

The compound is called 2,2,3-trimethylbutane.


What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?

The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.