answersLogoWhite

0

Many compounds have this formula; for example tert-butylamine.

User Avatar

Bennett Bode

Lvl 13
3y ago

What else can I help you with?

Related Questions

Is ch3ch equals chch2ch3 polar?

No, ch3ch is not polar because it is a nonpolar molecule due to the symmetric arrangement of its carbon and hydrogen atoms. The molecule is nonpolar as the electronegativities of carbon and hydrogen are very similar, resulting in no significant charge separation.


What is the structure for 3-chlorobutanamide?

CH3CH(Cl)-CH2-CONH2


Is adenine polar or non polar?

Alanine is an amphoteric substance: both acidic and basic at the same time. However, it is neutral in a pH = 6.1 solution: CH3CH(NH3+)COO- It is positvely charged ( by excess of H+) at lower pH sol'n CH3CH(NH3+)COOH and negatively in pure water or more basic solution CH3CH(NH2)COO-.


What is the chemical name for isopropyl alcohol?

Ch3ch(oh)ch3


What is name of ch3chch3ch2cho?

The name of the compound CH3CH(CH3)CH2CHO is 2-methylbutanal.


What is the name of the compound CH3CH(CH3)C(CH3)?

The compound is called 2,2,3-trimethylbutane.


What is condensed structure for 2-butanol?

The condensed structure for 2-butanol is CH3CH(CH3)CH2OH.


What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?

The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.


What is the name for ch3chch3chch3ch3?

The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.


Which formula represents 2-butene?

Buthane is a saturated hydrocarbon. That means all the bonds found in this molecule are single covalent bond. Its formula is C4H10. It is the fourth member of the alkane siri.


What is the structural formula of propene?

The formula for propylene is CH3CH=CH2 and the Hill formula is C3H6. It has a boiling point of -53.68 degrees Fahrenheit.


What is the name of CH3CH(CH3)CH2CH2CH2CH3?

CH3CH2CH2C(CH3)2CH3 is 2,2-dimethylpentane