0
What else can I help you with?
What is the molecular shape for ch2 double bond c double bond ch2?
The molecular shape for CH2=CH2 (ethene) is trigonal planar, with a bond angle of 120 degrees. The carbon atoms are sp2 hybridized, resulting in the planar geometry.
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the full structural formula for CH2-CH2 in ethylene?
The structural formula is best displayed as a diagram, similar to H_ ..... _H H_C=C_H or (CH2)(CH2) In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
How many isomers are there of c4h8?
There 4 isomers : 1) H2C=CHCH2CH3 => but-1-ene 2) CH3CH=CHCH3 => but-2-ene 3) (CH3)2C=CHCH3 => 2- methylpropene 4) CH2-CH2-CH2-CH2 => cyclobutane/cycloalkane. C4h8 has 3 isomers from the same homologous series and one that is not from the same homologous series.
Why is it called 3-heptene?
The prefix "hept-" indicates that the molecule contains seven carbon atoms. The number 3 indicates the position of the double bond in the carbon chain. Therefore, "3-heptene" signifies a seven-carbon chain with a double bond at the third carbon.
What is the structural formula for trans-2-heptene?
CH3-CH=CH-CH2-CH2-CH2-CH3 if hydrogen of doble bonded carbons are at the same side of plane of double bond then it is cis isomer....
What is the correct name for the compound CH3CH2CH(DOUBLE BOND)CH-CH2-CH(DOUBLE BOND)CH-CH?
You think probable to cycloocta-1,5-diene.
Why is no number used in the names ethene and propene?
ethene: CH2=Ch2 propene: CH2=CH3CH There is nowhere else to place a double bond! (C=C) No number is used in the names ethene and propene because the number would be useless as the double bond is located at carbon "1"
What is the name compound ch3-ch2-ch2-chch2?
CH3-CH2-CH2-CH=CH2 will be names as 1-pentene or pent-1-ene
What is the structure for 3-chlorobutanamide?
CH3CH(Cl)-CH2-CONH2
What is name of ch2 double bond o?
The name of CH2 double bond O is methylene and it is commonly found in aldehydes and ketones, where the carbon is bonded to the oxygen through a double bond.
What is the molecular shape for ch2 double bond c double bond ch2?
The molecular shape for CH2=CH2 (ethene) is trigonal planar, with a bond angle of 120 degrees. The carbon atoms are sp2 hybridized, resulting in the planar geometry.
Condensed structural formula for 1-butyne?
butanal is analdehyde. An oxygen atom is attached to a carbon chain by a double bond and therefre called a carbonyl group. It is found at the end of a carbon atom/chain. CH3-CH2-CH2-CH=O
What is a doble bond?
A double bond is a covalent bond where 4 electrons are shared as in H2C=CH2
What is the of 4 4?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
