answersLogoWhite

0

The compound CH3CH=CH2 is propene, which is also known as propylene. It is an unsaturated hydrocarbon with a double bond between the second and third carbon atoms in the chain.

User Avatar

AnswerBot

1y ago

What else can I help you with?

Related Questions

What is the structural formula for trans-2-heptene?

CH3-CH=CH-CH2-CH2-CH2-CH3 if hydrogen of doble bonded carbons are at the same side of plane of double bond then it is cis isomer....


What is the correct name for the compound CH3CH2CH(DOUBLE BOND)CH-CH2-CH(DOUBLE BOND)CH-CH?

You think probable to cycloocta-1,5-diene.


Why is no number used in the names ethene and propene?

ethene: CH2=Ch2 propene: CH2=CH3CH There is nowhere else to place a double bond! (C=C) No number is used in the names ethene and propene because the number would be useless as the double bond is located at carbon "1"


What is the name compound ch3-ch2-ch2-chch2?

CH3-CH2-CH2-CH=CH2 will be names as 1-pentene or pent-1-ene


What is the structure for 3-chlorobutanamide?

CH3CH(Cl)-CH2-CONH2


What is name of ch2 double bond o?

The name of CH2 double bond O is methylene and it is commonly found in aldehydes and ketones, where the carbon is bonded to the oxygen through a double bond.


What is the molecular shape for ch2 double bond c double bond ch2?

The molecular shape for CH2=CH2 (ethene) is trigonal planar, with a bond angle of 120 degrees. The carbon atoms are sp2 hybridized, resulting in the planar geometry.


Condensed structural formula for 1-butyne?

butanal is analdehyde. An oxygen atom is attached to a carbon chain by a double bond and therefre called a carbonyl group. It is found at the end of a carbon atom/chain. CH3-CH2-CH2-CH=O


What is a doble bond?

A double bond is a covalent bond where 4 electrons are shared as in H2C=CH2


What is the of 4 4?

4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.


What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?

oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.