0
Formaldehyde, or methanal
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
How do you draw 3-ethylhexanoic acid in line-bond form?
CH3-CH2-CH2-C(CH2-CH3)-CH2-C double bonded to O & single bonded to O-H to form a carboxylic acid
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the name for ch3-ch2-ch2-ch2-o-c6h5?
It is 1-butoxy benzene
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
What is the molecular shape for ch2 double bond c double bond ch2?
h | h-c=o
How do you draw 3-ethylhexanoic acid in line-bond form?
CH3-CH2-CH2-C(CH2-CH3)-CH2-C double bonded to O & single bonded to O-H to form a carboxylic acid
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the name for ch3-ch2-ch2-ch2-o-c6h5?
It is 1-butoxy benzene
What is the Structure of hexanal?
The structural formula of hexane isCH3(CH2)4CH3For skeletal and other graphical representations, seehttp://en.wikipedia.org/wiki/HexaneC6H12 It is an alkane ,a hydrocarbon
What is the structure of ethyl octanoate?
Ch3 -ch2 -o-c(o)-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
What is the structure of ethyl alcohol?
Ethyl alcohol, which is the old name for ethanol, is H3C-CH2OH
Condensed structural formula for 1-butyne?
butanal is analdehyde. An oxygen atom is attached to a carbon chain by a double bond and therefre called a carbonyl group. It is found at the end of a carbon atom/chain. CH3-CH2-CH2-CH=O
What kind of bond holds O2 together?
Double bond with two sets of lone pairs on each O. .. .. O=O .. ..
What type of bond is CO2?
A double covalent bond. Each oxygen form a double covalent bond to caron. Structurally it is shown as 'O-C-O'.
