answersLogoWhite

0

h

| h-c=o

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What is name of ch2 double bond o?

The name of CH2 double bond O is methylene and it is commonly found in aldehydes and ketones, where the carbon is bonded to the oxygen through a double bond.


What is a doble bond?

A double bond is a covalent bond where 4 electrons are shared as in H2C=CH2


What is the of 4 4?

4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.


What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?

oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches


What compound is CH3--CH double bond CH2?

The compound CH3CH=CH2 is propene, which is also known as propylene. It is an unsaturated hydrocarbon with a double bond between the second and third carbon atoms in the chain.


What is the structural formula for trans-2-heptene?

CH3-CH=CH-CH2-CH2-CH2-CH3 if hydrogen of doble bonded carbons are at the same side of plane of double bond then it is cis isomer....


What is the difference between 2-hexene and 3-hexene?

The difference between 2-hexene and 3-hexene lies in the position of the double bond in the hexene molecule. In 2-hexene, the double bond is located on the second carbon atom of the hexane chain, while in 3-hexene, the double bond is located on the third carbon atom of the hexane chain.


What is the full structural formula for CH2-CH2 in ethylene?

The structural formula is best displayed as a diagram, similar to H_ ..... _H H_C=C_H or (CH2)(CH2) In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.


What is the structure of 4-methyl-4-nonene?

4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.


Why is it called 3%?

3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3


What is the correct name for the compound CH3CH2CH(DOUBLE BOND)CH-CH2-CH(DOUBLE BOND)CH-CH?

You think probable to cycloocta-1,5-diene.


Why 3 called 3?

3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3