answersLogoWhite

0

3-Hexene: CH3CH2CH=CHCH2CH3 to name alkenes: -identify the parent chain (how many carbon atoms are in formula=prefix) there are 6 carbon atoms so the prefix is "hex" (prefixes are online) then add the end of the word alkene --> "ene" to that prefix. -Label where the double bond is located (on which carbon atom that has the lowest numeral positioning, numbering from either side) 3-hexene, you know that the double bond is at the 3rd carbon atom -the hydrogen atoms are determined by the number of covalent bonds the carbon atom can have (4) the first "C" has 3 hydrogen atoms bonded to it because it's only using one bond the second "C" has only 2 because its bonding in front and behind it (using 2) the third "C" has 1, the double bond takes 2 and the bond behind uses 1 (3) hope this helps -Autumn

User Avatar

Wiki User

17y ago

What else can I help you with?

Related Questions

What is the chemical formula for 2-methyl-2hexene?

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.


A multiple of an empirical formula is often called what?

molecular formula :]-kyrstiann dynae :]


What is the molecular formula of the principal molecular or ionic species present in glucose?

It is a molecular species with the formula C6H12O6


What is the molecular formula of a compound that has a molecular mass of 54 and the empirical formula C2H3?

The empirical formula C2H3 has a molecular mass of 27 (C: 12, H: 1). To determine the molecular formula with a molecular mass of 54, the molecular formula would simply be double the empirical formula, so the molecular formula would be C4H6.


What is the molecular formula of erythro?

The molecular formula for erythro is as follows C37H67NO13.


What is the Molecular formula for NO2?

NO2 is the molecular formula for NO2.


What is the molecular formula for startch?

The molecular formula for Starch is C6H10O5.


What is the molecular formula of methanate?

The molecular formula of methane is CH4


What is the Molecular formula for 2-butyne?

What is the molecular formula of 2-Butyne


Is CCI4 a molecular formula or formula unit?

CCl4 is molecular formula.


What is molecular formula for hydrocarbon styrene?

The chemical formula of styrene is C6H5CH=CH2


Vitamin c has an emperical formula of c3h4o3 and a molecular mass of 176what is the molecular formula of vitamin c?

To find the molecular formula from the empirical formula, we need to know the molar mass of the empirical formula. In this case, the empirical formula's molar mass is 88. To find the molecular formula, we divide the given molecular mass (176) by the empirical formula's molar mass (88) to get 2. This means the molecular formula of Vitamin C is twice the empirical formula, so the molecular formula is C6H8O6.