3-Hexene: CH3CH2CH=CHCH2CH3 to name alkenes: -identify the parent chain (how many carbon atoms are in formula=prefix) there are 6 carbon atoms so the prefix is "hex" (prefixes are online) then add the end of the word alkene --> "ene" to that prefix. -Label where the double bond is located (on which carbon atom that has the lowest numeral positioning, numbering from either side) 3-hexene, you know that the double bond is at the 3rd carbon atom -the hydrogen atoms are determined by the number of covalent bonds the carbon atom can have (4) the first "C" has 3 hydrogen atoms bonded to it because it's only using one bond the second "C" has only 2 because its bonding in front and behind it (using 2) the third "C" has 1, the double bond takes 2 and the bond behind uses 1 (3) hope this helps -Autumn
molecular formula :]-kyrstiann dynae :]
The molecular formula for erythro is as follows C37H67NO13.
The chemical formula of styrene is C6H5CH=CH2
Benzene has the molecular formula C6H6.
The molecular formula for lithium chromate is Li2CrO4.
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
molecular formula :]-kyrstiann dynae :]
The empirical formula C2H3 has a molecular mass of 27 (C: 12, H: 1). To determine the molecular formula with a molecular mass of 54, the molecular formula would simply be double the empirical formula, so the molecular formula would be C4H6.
It is a molecular species with the formula C6H12O6
The molecular formula for erythro is as follows C37H67NO13.
NO2 is the molecular formula for NO2.
The molecular formula for Starch is C6H10O5.
The molecular formula of methane is CH4
What is the molecular formula of 2-Butyne
CCl4 is molecular formula.
The chemical formula of styrene is C6H5CH=CH2
To find the molecular formula from the empirical formula, we need to know the molar mass of the empirical formula. In this case, the empirical formula's molar mass is 88. To find the molecular formula, we divide the given molecular mass (176) by the empirical formula's molar mass (88) to get 2. This means the molecular formula of Vitamin C is twice the empirical formula, so the molecular formula is C6H8O6.