0
Benzoic acid and n-octyl alcohol in presence of sulphuric acid on heating form octyl benzoate and water.
Wiki User
∙ 14y ago
Wiki User
∙ 11y agon-octyl alochol and benzoic acid
Add your answer:
Earn +20 pts
Octyl formate has flavor oranges name the alcohol and the caborxylic acid needed to synthesis this ester?
octyl alcohol and formic acid
What ester is formed when acetic acid reacts with octyl alcohol?
It forms Octyl Acetate.
What is the carboxylic acid needed to form isobutyl benzoate?
Benzoic acid esterified with the alcohol isobutanol gives isobutyl benzoate.
What smell is produced when acetic acid combines with n octyl alcohol?
orange
What smell is produced when acetic acid combines with n-octyl alcohol?
You're supposed to get an orange scent
Octyl formate has flavor oranges name the alcohol and the caborxylic acid needed to synthesis this ester?
octyl alcohol and formic acid
What ester is formed when acetic acid reacts with octyl alcohol?
It forms Octyl Acetate.
What is the carboxylic acid needed to form isobutyl benzoate?
Benzoic acid esterified with the alcohol isobutanol gives isobutyl benzoate.
What smell is produced when acetic acid combines with n octyl alcohol?
orange
What smell is produced when acetic acid combines with n-octyl alcohol?
You're supposed to get an orange scent
Is benzene the same as benzoate?
No. Bensene and Benzoate are not the same. Benzene has the formula C6H6 (a ring of 6 carbons, each with a hydrogen bonded to it), and benzoate has the formula C6H5COO−. Benzoate is a benzene molecule that has a carboxylic acid group attached to it (except that the acid group is deprotonated). Benzoate is the conjugate base of benzoic acid. See the Web Links to the left of this answer for more information.
What product forms when ethyl benzoate is treated with water and hydrocholride and heat?
Hydrolysis - the ester would be hydrolyzed to its component acid and alcohol (benzoic acid and ethanol, respectively).
What is the trade name for benzoic acid?
BENZOATE
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
What combination of alcohol and acid will form the ester ethyl acetate?
Acetic acid and ethanol alcohol will form ethyl acetate.
Ester formed between 1-octanol and glacial acetic acid?
Octyl Acetate
Why is hydrochloric acid added in a molar absorptivity of benzoic acid?
It is added to protonate the sodium benzoate.
