answersLogoWhite

0

the ester formed is methyl benzoate which is also known as oil of wintergreen

User Avatar

Wiki User

∙ 17y ago

What else can I help you with?

Related Questions

What combination of alcohol and acid will form octyl benzoate?

Octyl benzoate can be formed by reacting octanol (alcohol) and benzoic acid in the presence of a catalyst like sulfuric acid. The reaction will produce octyl benzoate and water as byproduct.


What ester is formed when acetic acid reacts with octyl alcohol?

Ethanoic (Acetic) Acid + Octanol(Octyl alcohol) = Octyl Ethanoate ( Octyl Acetate). and water . Here is the BALANCED reaction eq'n. CH3COOH + CH3(CH2)6CH2OH CH3(CH2)6CH2OOCCH3 + H2O


Ester formed between 1-octanol and glacial acetic acid?

The ester formed between 1-octanol and glacial acetic acid is octyl acetate. This reaction involves the condensation of the hydroxyl group of 1-octanol with the carboxyl group of acetic acid, resulting in the formation of the ester bond. Octyl acetate is commonly used as a flavor and fragrance ingredient due to its fruity aroma.


Is alkyl benzoate ionic or covalent?

Alkyl benzoate is a covalent compound. It is formed by the sharing of electrons between the carbon and oxygen atoms in the ester functional group.


What is the structure of n-butyl benzoate?

n-Butyl benzoate is an ester compound formed from butanol and benzoic acid. Its structure consists of a benzene ring attached to a butyl group via an ester linkage.


Is methyl benzoate an ester?

Methyl benzoate, an organic compound, is an ester. It is a colorless liquid that is not soluble in water and has a fruity smells. Some uses for methyl benzoate are as a solvent and a pesticide.


Are benzene and benzoate the same?

No, benzene and benzoate are not the same. Benzene is a hydrocarbon compound with a ring structure, while benzoate is the salt or ester of benzoic acid.


What is the product formed when benzoic acid reacts with ethanol?

The product formed when benzoic acid reacts with ethanol is ethyl benzoate, along with water. This reaction is an esterification process, where the -OH group of the benzoic acid reacts with the -OH group of ethanol to form the ester and water as a byproduct.


What is the ester formed from acetic acid and n-pentyl alcohol?

Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.


What product forms when ethyl benzoate is treated with water and hydrocholride and heat?

The product formed would be benzoic acid. Ethyl benzoate reacts with water in the presence of hydrochloric acid and heat to undergo hydrolysis, breaking the ester bond. This results in the formation of benzoic acid and ethanol.


Octyl formate has flavor oranges name the alcohol and the caborxylic acid needed to synthesis this ester?

To synthesize octyl formate, you would need octanol as the alcohol and formic acid as the carboxylic acid. The reaction between octanol and formic acid, catalyzed by an acid catalyst, would result in the formation of octyl formate along with water as a byproduct.


Orange tastes like?

Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).