Carbon Dioxide (CO2) is the only gas produced in the reaction. The full reaction proceeds in two steps: first Nitric acid reacts with sodium carbonate to yield sodium nitrate and sodium bicarbonate. At this point the reaction would cease, but as long as there is excess Nitric acid the newly formed Sodium bicarbonate can be broken down further into another mole of sodium nitrate, water and gaseous Carbon dioxide (CO2) which mostly escapes the reaction quickly into the air, unless it is in a sealed airtight container, then it will remain in the liquid until opened like a can of cola! The two reactions are depicted below:
HNO3(aq) + Na2CO3(aq) --> NaNO3(aq) + NaHCO3(aq)
NaHCO3(aq) + HNO3(aq) --> NaNO3(aq) + H2O(l) + CO2(g)
Carbon dioxide is evolved.
Dilute Nitric acid when reacted with Sodium hydroxide will produce Sodium nitrate and Water. NaOH + HNO3 = NaNO3 + H2O.
2 HNO3 + Na2CO3 ---> H2CO3 + 2 NaNO3 Nitric acid + sodium carbonate ---> carbonic acid + sodium nitrate
Sodium carbonate (Na2CO3) and nitric acid (HNO3) make sodium nitrate (NaNO3), water (H2O) and carbon dioxide (CO2).
2HNO3 + Na2CO3 ----> 2NaNO3 + H2O + CO2 Two molecules of the nitric acid react with one molecule of sodium carbonate to produce one molecule of sodium nitrate, one molecule of water and one molecule of carbon dioxide gas. This is because acids always react with basic carbonates to produce a salt, water and carbon dioxide.
Na2CO3+2(HNO3)=2(NaNO3)+H20+CO2
Dilute Nitric acid when reacted with Sodium hydroxide will produce Sodium nitrate and Water. NaOH + HNO3 = NaNO3 + H2O.
2 HNO3 + Na2CO3 ---> H2CO3 + 2 NaNO3 Nitric acid + sodium carbonate ---> carbonic acid + sodium nitrate
Sodium carbonate (Na2CO3) and nitric acid (HNO3) make sodium nitrate (NaNO3), water (H2O) and carbon dioxide (CO2).
2HNO3 + Na2CO3 ----> 2NaNO3 + H2O + CO2 Two molecules of the nitric acid react with one molecule of sodium carbonate to produce one molecule of sodium nitrate, one molecule of water and one molecule of carbon dioxide gas. This is because acids always react with basic carbonates to produce a salt, water and carbon dioxide.
Na2CO3+2(HNO3)=2(NaNO3)+H20+CO2
NaHCO3 + HNO3 = CO2 + H2O + NaNO3
When Na2CO3 reacts with Nitric acid, The products at first are Sodium Hydrogen Carbonate and Sodium Nitrate... HNO3 + Na2CO3 --> NaNO3 + NaHCO3 If again The leftover Sodium hydrogen carbonate is made to react with Nitric Acid, then the products will be: HNO3 + NaHCO3 --> NaNo3 + H2O + CO2
NaF(aq) + HNO3(aq) ----> NaNO3(aq) + HF(aq)
Calcium Carbonate + Nitric acid ----> Calcium Nitrate + Water + Carbon dioxideCaCO3 + 2 HNO3 ----> Ca(NO3)2 + H2O + CO2
The chemical reaction is:Na2CO3 + 2 HNO3 = 2 NaNO3 + CO2 + H2O
Na2CO3 + 2 HNO3 --> 2 NaNO3 + CO2 + H2O
the equation isCa + HNO3 ----> Ca(NO3)2 + H2 reactants products