0
What else can I help you with?
What is action of cold and hot HI on ethyl methyl ether?
cold solution of HI forms ethyl methyl oxonium ion and iodide ion while hot condition ethyl methyl ether undergoes the substitution reaction with HI. C2H5-O-CH3 HI ----Cold---> C2H5-O+(H)-CH3 + I- ----Hot----> C2H5-OH + CH3-I and CH3-OH + C2H5-I
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the name of one carbon alkyl substituent?
CH3, methyl; ethyl, C2H5; amyl nowadays called pentyl, C5H11.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the condensed formula for 3-ethyl-2-methylpentane?
The condensed formula of 3-ethylpentane (CH2CH3)2CHCH2CH3 . Added: Another more trivial name is tri-ethyl methane CH(CH2CH3)3.
Can we write CH3-O-C2H5 as C2H5-O-CH3 for ethyl methyl ether?
No, the chemical structure CH3-O-C2H5 should be written as CH3-O-C2H5 for ethyl methyl ether. The order of the groups is based on the IUPAC naming rules, where the groups are listed in alphabetical order.
What is the structual formula for ether?
R-O-R where , R = alkyl group For Example, CH3 - O -CH3 is di-methyl ether, C2H5 - O -C2H5 is di-ethyl ether, C2H5 - O - CH3 is ethyl methyl ether......etc.
The difference between amino acids are in the?
In the R group which may be H, CH3 , C2H5, etc.
What is action of cold and hot HI on ethyl methyl ether?
cold solution of HI forms ethyl methyl oxonium ion and iodide ion while hot condition ethyl methyl ether undergoes the substitution reaction with HI. C2H5-O-CH3 HI ----Cold---> C2H5-O+(H)-CH3 + I- ----Hot----> C2H5-OH + CH3-I and CH3-OH + C2H5-I
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the chemical formula for ethyl alcohol?
The chemical formula for ethyl alcohol is C2H5OH.
What is the name of one carbon alkyl substituent?
CH3, methyl; ethyl, C2H5; amyl nowadays called pentyl, C5H11.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the balanced equation of methyl ethyl ketone when burnt in air?
Reactants and products:CH3-CO-C2H5 + ?O2 --> ?CO2 + ?H2O First C has to be balanced (1+1+2 --> ?CO2 , so ?=4)CH3-CO-C2H5 + ?O2 --> 4 CO2 + ?H2O Then H : (3+0+5 --> 8 H atoms = 4*2 in 4H2O)CH3-CO-C2H5 + ?O2 --> 4 CO2 + 4 H2O Finally balancing O : (1+?*2 11)2 CH3-CO-C2H5 + 11 O2 --> 8 CO2 + 8 H2O Contole: on O: 2*1 + 11*2 = 24 = 8*2 + 8*1 ,(since O is in all reactants and products, the other elements (C and H) are also balanced)Answer: 2 CH3-CO-C2H5 + 11 O2 --> 8 CO2 + 8 H2O
What is the condensed formula for 3-ethyl-2-methylpentane?
The condensed formula of 3-ethylpentane (CH2CH3)2CHCH2CH3 . Added: Another more trivial name is tri-ethyl methane CH(CH2CH3)3.
What is the name of C2H5?
C2H5 is the ethyl group.
Draw the structure for 4 ethyl 3 methyl 2 heptene?
h | h - c- h | h - c- h | c=c-c-c-c=c-c the rest of the h's are common sense to fill in but i dont have space ok, don't think the structure is compatible here. that ethyl group should be on the 4th carbon in the horisontal chain
