0
In crystallography, the orthorhombic crystal system is one of the seven lattice point groups. Orthorhombic lattices result from stretching a cubic lattice along two of its orthogonal pairs by two different factors, resulting in a rectangular prism with a rectangular base (a by b) and height (c), such that a, b, and c are distinct. All three bases intersect at 90° angles. The three lattice vectors remain mutually orthogonal. There are four orthorhombic Bravais lattices: simple orthorhombic, base-centered orthorhombic, body-centered orthorhombic, and face-centered orthorhombic.
What else can I help you with?
What is the most common allotrope of sulfur?
The most common allotrope of sulfur is orthorhombic sulfur, also known as rhombic sulfur. It exists in a yellow crystalline form at room temperature and pressure.
What is the peridot chemical formula and structure?
The chemical formula for peridot is (Mg, Fe)2SiO4. Peridot has an orthorhombic crystal structure, with the silicon and oxygen atoms arranged in a tetrahedral shape, surrounded by magnesium and iron atoms.
Which type of crystalline solid forms has BaCl2?
The anhydrous barium chloride has an orthogonal crystalline structure.
What new substance will form when heat is applied to sulfur?
Mind you, I am discussing what happens when you heat sulfur, not when you make it combine with other different types of matter. sulfur is a base atomic element, and will not break down, it merely changes state. Yes by atomic bonding, it can also form into other states by chance or process, but we are only talking about applying heat in a beaker. although I had to look it up, they are three allotropic forms: orthorhombic, monoclinic and amorphous. when you heat orthorhombic sulfur it changes state, and by cooling reverts back to its previous state, unless you cool it quickly. if you cool it quickly it becomes amorphous but over time will revert back to orthorhombic.
What is an example of a monoclinic crystal?
Gypsum and orthoclase feldspar are in the monoclinic crystal system.
Orthorhombic crystal system?
symmetry
What type of crystallization in sulfur?
orthorhombic
How many equivalent planes 111 are there in a orthorhombic crystal?
There are 6 equivalent (111) planes in an orthorhombic crystal system. This is because in an orthorhombic crystal system, the axes are of different lengths and perpendicular to each other, creating 6 symmetrical orientations for the (111) planes.
What is an example for orthorhombic?
Sulfur is an example of a mineral that crystallizes in an orthorhombic crystal system. Its atoms are arranged in a structure with three mutually perpendicular axes of differing lengths.
What family is Topaz in?
It is a silicate mineral whose crystals are orthorhombic.
End centered orthorhombic is bravais lattice but tetragonal is not.why?
gaand marao
What the meaning about body centerde orthorhombic?
A body-centered orthorhombic structure is a type of crystal lattice system characterized by three mutually perpendicular axes of differing lengths. In this arrangement, there is one atom at each corner of the orthorhombic unit cell and one atom at the center of the cell, making it "body-centered." This structure is one of the seven crystal systems and is significant in materials science for understanding the properties of certain metals and alloys. Examples of materials with a body-centered orthorhombic structure include certain forms of phosphorus and certain metal alloys.
What is a wadsleyite?
A wadsleyite is a variety of orthorhombic olivine produced under very high pressure.
What is the crystal structure for Peridot?
Peridot (gem quality olivine (the mineral)) is in the orthorhombic crystal system.
Does topaz have a crystalline structure?
Absolutely. Topaz manifests an orthorhombic crystal structure in the dipyramidal class.
What is adelite?
Adelite is a rare mineral, forming blue, green, yellow or grey orthorhombic crystals.
What is zoisite?
Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).
