0
What else can I help you with?
Does topaz have a crystalline structure?
Absolutely. Topaz manifests an orthorhombic crystal structure in the dipyramidal class.
By which atom crystalline sulfur forms?
Sulfur exists in several crystalline and amorphous allotropes. The most common form is yellow, orthorhombic alpha-sulfur, which contains puckered rings of S8.
What are different class of crystals?
Minerals crystals are divided into six systems depending on the relationships of length of axes and angles between axes. The six mineral crystal systems are: cubic, hexagonal, trigonal, tetragonal, orthorhombic, triclinic, and monoclinic.
What is crystal shape is fluorite?
Feldspar makes up over half of the earth's crust. It consists of continuous, negatively charged, three-dimensional framework that is made up of corner-sharing tetrahedrons and positively charged cations.
How many sides do crystals of each of the six major crystal systems have?
Cubic: crystals have 6 sides. Tetragonal: crystals have 4 sides. Orthorhombic: crystals have 3 unequal sides. Hexagonal: crystals have 6 sides. Monoclinic: crystals have 4 sides. Triclinic: crystals have no set number of sides.
What is a Orthorhombic?
In crystallography, the orthorhombic crystal system is one of the seven lattice point groups. Orthorhombic lattices result from stretching a cubic lattice along two of its orthogonal pairs by two different factors, resulting in a rectangular prism with a rectangular base (a by b) and height (c), such that a, b, and c are distinct. All three bases intersect at 90° angles. The three lattice vectors remain mutually orthogonal. There are four orthorhombic Bravais lattices: simple orthorhombic, base-centered orthorhombic, body-centered orthorhombic, and face-centered orthorhombic.
Orthorhombic crystal system?
symmetry
What type of crystallization in sulfur?
orthorhombic
How many equivalent planes 111 are there in a orthorhombic crystal?
There are 6 equivalent (111) planes in an orthorhombic crystal system. This is because in an orthorhombic crystal system, the axes are of different lengths and perpendicular to each other, creating 6 symmetrical orientations for the (111) planes.
What family is Topaz in?
It is a silicate mineral whose crystals are orthorhombic.
End centered orthorhombic is bravais lattice but tetragonal is not.why?
gaand marao
What is a wadsleyite?
A wadsleyite is a variety of orthorhombic olivine produced under very high pressure.
What is an example of a monoclinic crystal?
Gypsum and orthoclase feldspar are in the monoclinic crystal system.
What is the crystal structure for Peridot?
Peridot (gem quality olivine (the mineral)) is in the orthorhombic crystal system.
What is adelite?
Adelite is a rare mineral, forming blue, green, yellow or grey orthorhombic crystals.
Does topaz have a crystalline structure?
Absolutely. Topaz manifests an orthorhombic crystal structure in the dipyramidal class.
What is zoisite?
Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).
