answersLogoWhite

0

  • Sodium hydroxide, NaOH, is also known as lye or caustic soda.
  • Sodium hydroxide is a commonly used base.
  • equation for formation of sodium hydroxide is below.
  • 2NaCl(aq) + 2H2O(l) -----> H2(g) + Cl2(g) + 2NaOH(aq).
User Avatar

Wiki User

11y ago

What else can I help you with?

Related Questions

What is the net ionic equation in the form of precipitate for aluminium sulfate and sodium hydroxide?

The net ionic equation for aluminum sulfate and sodium hydroxide is Al^3+ + 3OH^- -> Al(OH)3(s). This represents the formation of solid aluminum hydroxide as a precipitate.


What is the balanced equation of ferric chloride sodium hydroxed solid ferric hydroxide?

The balanced chemical equation for the reaction between ferric chloride (FeCl₃) and sodium hydroxide (NaOH) to form solid ferric hydroxide (Fe(OH)₃) and sodium chloride (NaCl) is: [ \text{FeCl}_3 + 3\text{NaOH} \rightarrow \text{Fe(OH)}_3 (s) + 3\text{NaCl} ] In this reaction, one mole of ferric chloride reacts with three moles of sodium hydroxide to produce one mole of solid ferric hydroxide and three moles of sodium chloride.


What happens when copper chloride is mixed with sodium hydroxide?

When copper chloride is mixed with sodium hydroxide, a precipitation reaction occurs where solid copper(II) hydroxide is formed. The balanced chemical equation for this reaction is: CuCl2 + 2NaOH → Cu(OH)2 + 2NaCl. This reaction is a double displacement reaction where copper ions and hydroxide ions switch partners to form the solid copper hydroxide.


Solid sodium hydroxide Decomposes into gaseous water and solid sodium oxide?

Solid sodium hydroxide will decompose into gaseous water and solid sodium oxide when heated to high temperatures. This decomposition reaction is a result of the breakdown of sodium hydroxide into its constituent elements due to the input of energy. Water vapor is released while sodium oxide remains as a solid residue.


Sodium hydroxide combined with cadmium chloride?

When sodium hydroxide combines with cadmium chloride, it forms cadmium hydroxide and sodium chloride as products. The balanced chemical equation for this reaction is: 2 NaOH + CdCl2 → Cd(OH)2 + 2 NaCl. Cadmium hydroxide is a white solid that tends to precipitate out of solution.


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).


What happens when you add sodium hydroxide to copper bromide?

When you combine these substances, a metathesis reaction occurs. In this reaction, copper becomes bonded to hydroxide ions. Because copper hydroxide is insoluble, it precipitates out of solution.


React iron iii nitrate and sodium hydroxide?

When iron (III) nitrate reacts with sodium hydroxide, it forms iron (III) hydroxide and sodium nitrate. The balanced chemical equation for this reaction is: Fe(NO3)3 + 3NaOH → Fe(OH)3 + 3NaNO3. Iron (III) hydroxide is a brown solid that forms as a precipitate in this reaction.


Is sodium hydroxide solid?

Yes. Sodium hydroxide is solid under standard conditions, but it is often distributed in an aqueous solution.


Why does copper II nitrate and sodium hydroxide make a precipitate?

When copper (II) nitrate and sodium hydroxide are mixed, a chemical reaction occurs, resulting in the formation of copper (II) hydroxide, which is insoluble in water. This insoluble compound precipitates out of the solution, appearing as a solid.


What happens if you mix ferric sulphate and sodium hydroxide?

When ferric sulfate is mixed with sodium hydroxide, a red-brown precipitate of iron(III) hydroxide is formed, along with the formation of water as a byproduct. The reaction is strongly exothermic. This precipitate is insoluble in water and can easily be seen as a solid settling at the bottom of the reaction mixture.


What is the bonding of sodium hydroxide?

Sodium hydroxide is an ionic compound, meaning it forms bonds through the transfer of electrons. Sodium donates an electron to hydroxide, resulting in the formation of Na+ and OH- ions. These oppositely charged ions attract each other through electrostatic forces to form a solid lattice structure.