The given collection of symbols is one way of writing the formula of a straight-chain hydrocarbon with 9 carbon atoms, which has the name "nonane".
More conventionally: all the letters in the formula should be capitalized, since they represent the chemical elements hydrogen and carbon; the numbers should all be subscripts instead of being on the same base as the letters; and there should be a hyphen, representing a chemical bond, between each two groupings written without spaces, where there is now simply a space. The formula can also be written more compactly as H3C(CH2)7CH3.
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
H3C-C-CH2-CH3 is a hydrocarbon as it consists only of carbon and hydrogen atoms bonded together in a chain without any functional groups attached.
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
butonal
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
H3C-C-CH2-CH3 is a hydrocarbon as it consists only of carbon and hydrogen atoms bonded together in a chain without any functional groups attached.
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
The condensed formula for N-ethyl-N-ethanamide is EtNHCH2CH3.
The C in h3c is sp3 hybridized The c in ch is sp2 hybridized the c in ch2 is sp2 hybridized
3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3
3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3
butonal