0
The given collection of symbols is one way of writing the formula of a straight-chain hydrocarbon with 9 carbon atoms, which has the name "nonane".
More conventionally: all the letters in the formula should be capitalized, since they represent the chemical elements hydrogen and carbon; the numbers should all be subscripts instead of being on the same base as the letters; and there should be a hyphen, representing a chemical bond, between each two groupings written without spaces, where there is now simply a space. The formula can also be written more compactly as H3C(CH2)7CH3.
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is H3C-CH2-CH2-CH2-CH3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
functionalized hydrocarbon
What compound is this H3C-H3C-Cl-H-O?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
What is h3c--c--ch2--ch3?
butonal
What is H3C-CH2-CH2-CH2-CH3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What is h3c-c-ch2-ch3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?
One version is H3C-(CH2)8-CH3 = H2C=CH-CH2-CH3 + H3C(CH3)-(CH2)3-CH3).
What is the structure of ethyl alcohol?
Ethyl alcohol, which is the old name for ethanol, is H3C-CH2OH
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is condensed formula for N-ethyl-N-ethanamide?
H3c-ch2-nh-ch2-ch3
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
functionalized hydrocarbon
What compound is this H3C-H3C-Cl-H-O?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
What is h3c--c--ch2--ch3?
butonal
What is cl compound?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
Is the most complex organic molecules are hydrocarbon chains with nothing else attached?
The simplest organic molecules are hydrocarbon chains. methane CH4, ethane H3C-CH3, Propane H3C-CH2-CH3, etc....
What are the hybridization of the carbon atoms in CH3 CH2 COH?
The C in h3c is sp3 hybridized The c in ch is sp2 hybridized the c in ch2 is sp2 hybridized
